Citbismine C
Internal ID | 66c2c21f-05b0-4ae4-9660-c8499b13a131 |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines > Acridines > Acridones |
IUPAC Name | 5,9-dihydroxy-2-(2-hydroxypropan-2-yl)-1-(1-hydroxy-3,5,6-trimethoxy-10-methyl-9-oxoacridin-2-yl)-10-methoxy-11-methyl-1,2-dihydrofuro[2,3-c]acridin-6-one |
SMILES (Canonical) | CC(C)(C1C(C2=C(O1)C=C(C3=C2N(C4=C(C3=O)C=CC(=C4OC)O)C)O)C5=C(C=C6C(=C5O)C(=O)C7=C(N6C)C(=C(C=C7)OC)OC)OC)O |
SMILES (Isomeric) | CC(C)(C1C(C2=C(O1)C=C(C3=C2N(C4=C(C3=O)C=CC(=C4OC)O)C)O)C5=C(C=C6C(=C5O)C(=O)C7=C(N6C)C(=C(C=C7)OC)OC)OC)O |
InChI | InChI=1S/C37H36N2O11/c1-37(2,45)36-27(25-22(50-36)14-19(41)24-30(25)39(4)28-15(32(24)43)9-11-18(40)34(28)48-7)26-21(47-6)13-17-23(33(26)44)31(42)16-10-12-20(46-5)35(49-8)29(16)38(17)3/h9-14,27,36,40-41,44-45H,1-8H3 |
InChI Key | BDURUBOYNAVRCF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H36N2O11 |
Molecular Weight | 684.70 g/mol |
Exact Mass | 684.23190997 g/mol |
Topological Polar Surface Area (TPSA) | 168.00 Ų |
XlogP | 5.70 |
CHEBI:168674 |
169055-79-2 |
5,9-dihydroxy-2-(2-hydroxypropan-2-yl)-1-(1-hydroxy-3,5,6-trimethoxy-10-methyl-9-oxoacridin-2-yl)-10-methoxy-11-methyl-1,2-dihydrouro[2,3-c]acridin-6-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.15% | 89.00% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 96.99% | 80.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.95% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.33% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.66% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 94.15% | 89.62% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 93.65% | 93.65% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.39% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.04% | 93.99% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.29% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.58% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.88% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.20% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.48% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.80% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.45% | 97.25% |
CHEMBL2535 | P11166 | Glucose transporter | 83.93% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.65% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 82.30% | 95.78% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 82.12% | 95.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.37% | 92.62% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.32% | 94.42% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.52% | 97.14% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.50% | 95.71% |
CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 80.33% | 95.39% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.18% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
PubChem | 85149847 |
LOTUS | LTS0233497 |
wikiData | Q104924756 |