cis-Zeatin riboside monophosphate
Internal ID | 2e91e8f4-7069-4594-aa95-289910971fe8 |
Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleotides > Purine ribonucleotides > Purine ribonucleoside monophosphates |
IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(Z)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
SMILES (Canonical) | CC(=CCNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O)CO |
SMILES (Isomeric) | C/C(=C/CNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)/CO |
InChI | InChI=1S/C15H22N5O8P/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(28-15)5-27-29(24,25)26/h2,6-7,9,11-12,15,21-23H,3-5H2,1H3,(H,16,17,18)(H2,24,25,26)/b8-2-/t9-,11-,12-,15-/m1/s1 |
InChI Key | IRILMCCKFANGJQ-BAJUWZQUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C15H22N5O8P |
Molecular Weight | 431.34 g/mol |
Exact Mass | 431.12059967 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | -2.60 |
125225-71-0 |
((2R,3S,4R,5R)-3,4-Dihydroxy-5-(6-(((Z)-4-hydroxy-3-methylbut-2-en-1-yl)amino)-9H-purin-9-yl)tetrahydrofuran-2-yl)methyl dihydrogen phosphate |
CHEBI:80493 |
DTXSID701344701 |
Q27149545 |
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(Z)-4-hydroxy-3-methylbut-2-enyl]amino]purin-9-yl]oxolan-2-yl]methyl dihydrogen phosphate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 97.67% | 80.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 97.02% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.82% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.81% | 91.11% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.84% | 93.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.71% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.69% | 89.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.37% | 96.90% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.36% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.45% | 94.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 83.88% | 97.78% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.67% | 96.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.19% | 89.34% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.64% | 94.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.32% | 95.89% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.47% | 97.29% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.28% | 95.83% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.20% | 100.00% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.64% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 23724752 |
LOTUS | LTS0158244 |
wikiData | Q27149545 |