Cintriamide
| Internal ID | eacdab29-2498-44f1-bea3-10eb4cf2a57f |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid amides |
| IUPAC Name | (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C12H15NO4/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h4-7H,1-3H3,(H2,13,14)/b5-4+ |
| InChI Key | LRLKZVMLJBNNPE-SNAWJCMRSA-N |
| Popularity | 15 references in papers |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 70.80 Ų |
| XlogP | 0.80 |
| 5588-21-6 |
| Cintramida |
| Cintramidum |
| Cintriamide [USAN] |
| Cintramidum [INN-Latin] |
| Cintramida [INN-Spanish] |
| (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| 2-Propenamide, 3-(3,4,5-trimethoxyphenyl)- |
| NSC 170963 |
| NSC-170963 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.49% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.00% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.42% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.24% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.08% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.37% | 94.45% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 81.14% | 97.88% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.91% | 90.20% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.86% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alstonia lenormandii |
| PubChem | 6154037 |
| LOTUS | LTS0096938 |
| wikiData | Q27266124 |