Cinnamoylechinadiol
Internal ID | 8d08137c-2282-430c-81c9-bc246a2fa81b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Germacrane sesquiterpenoids |
IUPAC Name | [(1R,2R,3S,4R,6E,10S)-2-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=CCCC2(C(O2)C(C(C(C1)OC(=O)C=CC3=CC=CC=C3)C(C)C)O)C |
SMILES (Isomeric) | C/C/1=C\CC[C@]2([C@H](O2)[C@@H]([C@@H]([C@@H](C1)OC(=O)/C=C/C3=CC=CC=C3)C(C)C)O)C |
InChI | InChI=1S/C24H32O4/c1-16(2)21-19(27-20(25)13-12-18-10-6-5-7-11-18)15-17(3)9-8-14-24(4)23(28-24)22(21)26/h5-7,9-13,16,19,21-23,26H,8,14-15H2,1-4H3/b13-12+,17-9+/t19-,21-,22-,23-,24+/m1/s1 |
InChI Key | JBAYXBWJNDAHDZ-DXAOZSIRSA-N |
Popularity | 3 references in papers |
Molecular Formula | C24H32O4 |
Molecular Weight | 384.50 g/mol |
Exact Mass | 384.23005950 g/mol |
Topological Polar Surface Area (TPSA) | 59.10 Ų |
XlogP | 4.60 |
MEGxp0_000197 |
CHEBI:182125 |
AKOS040736440 |
NCGC00385049-01 |
[(1R,2R,3S,4R,6E,10S)-2-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] (E)-3-phenylprop-2-enoate |
NCGC00385049-01_C24H32O4_2-Propenoic acid, 3-phenyl-, (1R,2R,3S,4R,6E,10S)-2-hydroxy-6,10-dimethyl-3-(1-methylethyl)-11-oxabicyclo[8.1.0]undec-6-en-4-yl ester, (2E)- |
![2D Structure of Cinnamoylechinadiol 2D Structure of Cinnamoylechinadiol](https://plantaedb.com/storage/docs/compounds/2023/11/cinnamoylechinadiol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.89% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 97.21% | 94.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.71% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.01% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.55% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.29% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.73% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.21% | 96.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 92.48% | 94.23% |
CHEMBL5028 | O14672 | ADAM10 | 90.05% | 97.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.68% | 95.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.62% | 93.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.66% | 96.47% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.59% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.56% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.07% | 91.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.00% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.87% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.30% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.19% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Echinacea purpurea |
PubChem | 24039336 |
LOTUS | LTS0240316 |
wikiData | Q105124190 |