CID 72742747
Internal ID | 0482e091-a347-4468-b3ed-93c9a601e278 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)tetradec-1-ene-3,5-dione |
SMILES (Canonical) | CCCCCCCCCC(=O)CC(=O)C=CC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCCCCC(=O)CC(=O)C=CC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C21H30O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h11-15,24H,3-10,16H2,1-2H3 |
InChI Key | QJDGTTCAEQPSJA-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H30O4 |
Molecular Weight | 346.50 g/mol |
Exact Mass | 346.21440943 g/mol |
Topological Polar Surface Area (TPSA) | 63.60 Ų |
XlogP | 5.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.01% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.97% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.95% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.27% | 86.33% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.92% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.10% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.19% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.37% | 89.62% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.19% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 86.46% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.97% | 91.49% |
CHEMBL2535 | P11166 | Glucose transporter | 85.57% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.23% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.81% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.90% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.80% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 72742747 |
LOTUS | LTS0242718 |
wikiData | Q105222572 |