CID 6441218
| Internal ID | ef368c49-5f05-46ae-8e48-d2a781da37d6 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues > Milbemycins |
| IUPAC Name | [(3'R,4S,5'R,6S,6'S,8R,10E,13S,14E,16E,20R,21R,24S)-6'-[(E)-but-2-en-2-yl]-3',21,24-trihydroxy-5',11,13,22-tetramethyl-12-(2-methylpropanoyloxy)-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-4'-yl] 2-methylpropanoate |
| SMILES (Canonical) | CC=C(C)C1C(C(C(C2(O1)CC3CC(O2)CC=C(C(C(C=CC=C4COC5C4(C(C=C(C5O)C)C(=O)O3)O)C)OC(=O)C(C)C)C)O)OC(=O)C(C)C)C |
| SMILES (Isomeric) | C/C=C(\C)/[C@@H]1[C@H](C([C@H]([C@@]2(O1)C[C@@H]3C[C@H](O2)C/C=C(/C([C@H](/C=C/C=C/4\CO[C@H]5[C@@]4(C(C=C([C@H]5O)C)C(=O)O3)O)C)OC(=O)C(C)C)\C)O)OC(=O)C(C)C)C |
| InChI | InChI=1S/C42H60O12/c1-11-23(6)34-27(10)35(52-39(46)22(4)5)36(44)41(54-34)19-30-18-29(53-41)16-15-25(8)33(51-38(45)21(2)3)24(7)13-12-14-28-20-49-37-32(43)26(9)17-31(40(47)50-30)42(28,37)48/h11-15,17,21-22,24,27,29-37,43-44,48H,16,18-20H2,1-10H3/b13-12+,23-11+,25-15+,28-14+/t24-,27+,29+,30-,31?,32+,33?,34+,35?,36+,37+,41-,42+/m0/s1 |
| InChI Key | ZTHCHEYYZNTCSW-DRPUZNPESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C42H60O12 |
| Molecular Weight | 756.90 g/mol |
| Exact Mass | 756.40847734 g/mol |
| Topological Polar Surface Area (TPSA) | 167.00 Ų |
| XlogP | 4.40 |
| [(3'R,4S,5'R,6S,6'S,8R,10E,13S,14E,16E,20R,21R,24S)-6'-[(E)-But-2-en-2-yl]-3',21,24-trihydroxy-5',11,13,22-tetramethyl-12-(2-methylpropanoyloxy)-2-oxospiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-4'-yl] 2-methylpropanoate |
| UK 80694 |
| UK-80694 |
| Milbemycin B, 5-O-demethyl-28-deoxy-6,28-epoxy-22-hydroxy-13,23-bis(2-methyl-1-oxopropoxy)-25-(1-methyl-1-propenyl)-, (6R,13R,22R,23S,25S)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.25% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.13% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.22% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.92% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 91.25% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.36% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.15% | 96.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.98% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.87% | 89.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 87.90% | 95.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.69% | 96.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.20% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.03% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.80% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.17% | 97.21% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 85.18% | 97.53% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.86% | 94.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.59% | 94.45% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.24% | 93.40% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.65% | 91.07% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.08% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.52% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.80% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6441218 |
| LOTUS | LTS0208478 |
| wikiData | Q105382918 |