CID 495416
Internal ID | c0f6a30f-a6eb-4d9f-944f-14aeb2a52f7e |
Taxonomy | Benzenoids > Phenanthrenes and derivatives |
IUPAC Name | 15-[1-(2-hydroxy-1,6-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl)ethyl]-2-methyl-8-oxapentacyclo[9.8.0.02,7.07,9.012,17]nonadeca-4,12(17),13,15-tetraen-3-one |
SMILES (Canonical) | CC(C1CC2(C(O2)(C(O1)O)C)C)C3=CC4=C(C=C3)C5CC6C7(O6)CC=CC(=O)C7(C5CC4)C |
SMILES (Isomeric) | CC(C1CC2(C(O2)(C(O1)O)C)C)C3=CC4=C(C=C3)C5CC6C7(O6)CC=CC(=O)C7(C5CC4)C |
InChI | InChI=1S/C28H34O5/c1-15(21-14-25(2)27(4,33-25)24(30)31-21)16-7-9-18-17(12-16)8-10-20-19(18)13-23-28(32-23)11-5-6-22(29)26(20,28)3/h5-7,9,12,15,19-21,23-24,30H,8,10-11,13-14H2,1-4H3 |
InChI Key | CPHPTFZOHUSPRV-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C28H34O5 |
Molecular Weight | 450.60 g/mol |
Exact Mass | 450.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 71.60 Ų |
XlogP | 3.50 |
NSC654207 |
1-(5-hydroxy-1,6-dimethyl-4,7-dioxabicyclo[4.1.0]heptan-3-yl)ethyl-methyl-[?]one |
15-[1-(2-Hydroxy-1,6-dimethyl-3,7-dioxabicyclo[4.1.0]heptan-4-yl)ethyl]-2-methyl-8-oxapentacyclo[9.8.0.02,7.07,9.012,17]nonadeca-4,12(17),13,15-tetraen-3-one |
2,3-Anhydro-6-(12b-methyl-1-oxo-1,5a,6,6a,11,12,12a,12b-octahydro-4H-chryseno[6a,6-b]oxiren-9-yl)-4,6,7-trideoxy-2,3-dimethylheptopyranose |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.15% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.95% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.15% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.84% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.12% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.22% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.88% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.83% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.94% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.32% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 89.84% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 89.75% | 85.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.84% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.78% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.09% | 97.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.73% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.06% | 95.93% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.27% | 100.00% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 84.98% | 95.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.31% | 99.23% |
CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 83.81% | 92.50% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.57% | 93.40% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.52% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.51% | 92.62% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.31% | 96.77% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.18% | 96.21% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.76% | 91.19% |
CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 82.74% | 93.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.66% | 86.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.05% | 93.03% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.00% | 90.24% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.65% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Salpichroa origanifolia |
PubChem | 495416 |
LOTUS | LTS0241214 |
wikiData | Q104967545 |