CID 46873457
Internal ID | ff3474dd-3023-4bbd-8461-1e42922838e7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | |
SMILES (Canonical) | CC(C=C=C1C(CC(C(C1(C)O)OC2C(C(C(C(O2)CO)O)O)O)O)(C)C)O |
SMILES (Isomeric) | C[C@H](C=C=C1[C@]([C@@H]([C@H](CC1(C)C)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)(C)O)O |
InChI | InChI=1S/C19H32O9/c1-9(21)5-6-12-18(2,3)7-10(22)16(19(12,4)26)28-17-15(25)14(24)13(23)11(8-20)27-17/h5,9-11,13-17,20-26H,7-8H2,1-4H3/t6?,9-,10+,11-,13-,14+,15-,16-,17+,19+/m1/s1 |
InChI Key | RPJREIHZBZFGOB-IMXWEFONSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H32O9 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.20463259 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | -2.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.18% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.69% | 85.14% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.65% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 90.28% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.84% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.43% | 96.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.10% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.73% | 94.73% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.37% | 90.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.26% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.87% | 96.61% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.00% | 91.24% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.10% | 92.86% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.96% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.66% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.61% | 90.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.46% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crotalaria trichotoma |
PubChem | 46873457 |
LOTUS | LTS0224356 |
wikiData | Q105242730 |