CID 367138
Internal ID | 6fc715d1-3084-4827-9c7b-8f1de80e30f2 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | 2-[(11S,13S)-13,17,18-trihydroxy-2,10,14-trioxo-5,21-bis[(3,4,5-trihydroxybenzoyl)oxy]-7-[(3,4,5-trihydroxybenzoyl)oxymethyl]-3,6,9,15-tetraoxatetracyclo[10.7.1.14,8.016,20]henicosa-1(19),16(20),17-trien-11-yl]acetic acid |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C([C@@H](C(=O)O3)CC(=O)O)[C@@H](C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
InChI | InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7,14,22,24,30-31,33-34,41-48,51-55H,8-9H2,(H,49,50)/t14-,22?,24?,30-,31?,33?,34?,41?/m0/s1 |
InChI Key | YGVHOSGNOYKRIH-ZYGXXAJQSA-N |
Popularity | 41 references in papers |
Molecular Formula | C41H32O27 |
Molecular Weight | 956.70 g/mol |
Exact Mass | 956.11309574 g/mol |
Topological Polar Surface Area (TPSA) | 447.00 Ų |
XlogP | 0.70 |
Atomic LogP (AlogP) | 0.02 |
H-Bond Acceptor | 26 |
H-Bond Donor | 13 |
Rotatable Bonds | 9 |
NSC636589 |
C41H32O27 |
C41-H32-O27 |
18942-26-2 |
NSC-636589 |
2-[(11S,13S)-13,17,18-Trihydroxy-2,10,14-trioxo-5,21-bis[(3,4,5-trihydroxybenzoyl)oxy]-7-[(3,4,5-trihydroxybenzoyl)oxymethyl]-3,6,9,15-tetraoxatetracyclo[10.7.1.14,8.016,20]henicosa-1(19),16(20),17-trien-11-yl]acetic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.6426 | 64.26% |
Caco-2 | - | 0.8897 | 88.97% |
Blood Brain Barrier | - | 0.6750 | 67.50% |
Human oral bioavailability | - | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.5087 | 50.87% |
OATP2B1 inhibitior | - | 0.7131 | 71.31% |
OATP1B1 inhibitior | - | 0.3814 | 38.14% |
OATP1B3 inhibitior | + | 0.9108 | 91.08% |
MATE1 inhibitior | - | 0.7800 | 78.00% |
OCT2 inhibitior | - | 0.7750 | 77.50% |
BSEP inhibitior | + | 0.8233 | 82.33% |
P-glycoprotein inhibitior | + | 0.7251 | 72.51% |
P-glycoprotein substrate | - | 0.5512 | 55.12% |
CYP3A4 substrate | + | 0.6572 | 65.72% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8599 | 85.99% |
CYP3A4 inhibition | - | 0.8325 | 83.25% |
CYP2C9 inhibition | - | 0.9030 | 90.30% |
CYP2C19 inhibition | - | 0.9331 | 93.31% |
CYP2D6 inhibition | - | 0.8961 | 89.61% |
CYP1A2 inhibition | - | 0.9314 | 93.14% |
CYP2C8 inhibition | + | 0.6486 | 64.86% |
CYP inhibitory promiscuity | - | 0.9175 | 91.75% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6899 | 68.99% |
Eye corrosion | - | 0.9926 | 99.26% |
Eye irritation | - | 0.8909 | 89.09% |
Skin irritation | - | 0.8112 | 81.12% |
Skin corrosion | - | 0.9601 | 96.01% |
Ames mutagenesis | - | 0.5408 | 54.08% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6605 | 66.05% |
Micronuclear | + | 0.6992 | 69.92% |
Hepatotoxicity | - | 0.7250 | 72.50% |
skin sensitisation | - | 0.8727 | 87.27% |
Respiratory toxicity | + | 0.7222 | 72.22% |
Reproductive toxicity | + | 0.8222 | 82.22% |
Mitochondrial toxicity | + | 0.7000 | 70.00% |
Nephrotoxicity | - | 0.9238 | 92.38% |
Acute Oral Toxicity (c) | III | 0.5580 | 55.80% |
Estrogen receptor binding | + | 0.7870 | 78.70% |
Androgen receptor binding | + | 0.7662 | 76.62% |
Thyroid receptor binding | - | 0.4881 | 48.81% |
Glucocorticoid receptor binding | - | 0.5053 | 50.53% |
Aromatase binding | - | 0.5000 | 50.00% |
PPAR gamma | + | 0.7088 | 70.88% |
Honey bee toxicity | - | 0.7903 | 79.03% |
Biodegradation | - | 0.7750 | 77.50% |
Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
Fish aquatic toxicity | + | 0.8545 | 85.45% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293236 | P46063 | ATP-dependent DNA helicase Q1 |
112.2 nM |
Potency |
via Super-PRED
|
CHEMBL1293237 | P54132 | Bloom syndrome protein |
100 nM |
Potency |
via Super-PRED
|
CHEMBL2392 | P06746 | DNA polymerase beta |
177.8 nM |
Potency |
via Super-PRED
|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase |
2.2 nM |
Potency |
via Super-PRED
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
707.9 nM |
Potency |
via Super-PRED
|
CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
112.2 nM |
Potency |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
31.6 nM |
Potency |
via Super-PRED
|
CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
891.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.95% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.55% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.74% | 86.33% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.11% | 95.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.46% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 88.83% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.04% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.77% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.52% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.50% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.41% | 92.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.09% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.36% | 89.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.74% | 94.42% |
CHEMBL3194 | P02766 | Transthyretin | 84.40% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.38% | 94.73% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.34% | 91.19% |
CHEMBL3891 | P07384 | Calpain 1 | 82.41% | 93.04% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.85% | 80.78% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.78% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
Terminalia bellirica |
Terminalia chebula |