CID 22295735
Internal ID | 6b883d15-ca59-46a7-a9e5-1123f249a696 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aS,10aR)-6-hydroxy-1,1,4a-trimethyl-7-propan-2-yl-10,10a-dihydro-9H-phenanthren-2-one |
SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)CCC3C2(C=CC(=O)C3(C)C)C)O |
SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)CC[C@@H]3[C@@]2(C=CC(=O)C3(C)C)C)O |
InChI | InChI=1S/C20H26O2/c1-12(2)14-10-13-6-7-17-19(3,4)18(22)8-9-20(17,5)15(13)11-16(14)21/h8-12,17,21H,6-7H2,1-5H3/t17-,20+/m0/s1 |
InChI Key | POQWLCRKASQCAO-FXAWDEMLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O2 |
Molecular Weight | 298.40 g/mol |
Exact Mass | 298.193280068 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 5.10 |
(4aS,10aR)-6-hydroxy-1,1,4a-trimethyl-7-propan-2-yl-10,10a-dihydro-9H-phenanthren-2-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.85% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.80% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.76% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.48% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.05% | 94.75% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.57% | 93.40% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.41% | 93.99% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.96% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.46% | 100.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.15% | 95.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.61% | 95.89% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.93% | 96.77% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.90% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.79% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.32% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.60% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.47% | 95.89% |
CHEMBL4444 | P04070 | Vitamin K-dependent protein C | 81.37% | 93.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.97% | 93.18% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.89% | 93.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.66% | 93.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.64% | 93.04% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.62% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chamaecyparis obtusa |
PubChem | 22295735 |
LOTUS | LTS0074970 |
wikiData | Q105212627 |