(13R,16S)-12,12,16-Trimethyl-10,19,22-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-21-one
| Internal ID | 5896431f-c88f-44d4-aee6-9855084879dd |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | (13R,16S)-12,12,16-trimethyl-10,19,22-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-21-one |
| SMILES (Canonical) | CC1CCN2C13CC4C(C5=C(CC4(C2)C(=O)N3)C6=CC=CC=C6N5)(C)C |
| SMILES (Isomeric) | C[C@H]1CCN2C13C[C@@H]4C(C5=C(CC4(C2)C(=O)N3)C6=CC=CC=C6N5)(C)C |
| InChI | InChI=1S/C22H27N3O/c1-13-8-9-25-12-21-10-15-14-6-4-5-7-16(14)23-18(15)20(2,3)17(21)11-22(13,25)24-19(21)26/h4-7,13,17,23H,8-12H2,1-3H3,(H,24,26)/t13-,17+,21?,22?/m0/s1 |
| InChI Key | IEJLMMJWGODTGM-OHPWTWNFSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.215412493 g/mol |
| Topological Polar Surface Area (TPSA) | 48.10 Ų |
| XlogP | 3.50 |
| DTXSID20933467 |
| (1S,12aR)-1,12,12-Trimethyl-2,3,11,12,12a,13-hexahydro-1H,5H,6H-13a,5a-(azenometheno)indolizino[7,6-b]carbazol-15-ol |
| 1,12,12-Trimethyl-2,3,11,12,12a,13-hexahydro-1H,5H,6H-13a,5a-(azenometheno)indolizino[7,6-b]carbazol-15-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.23% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.55% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.51% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.62% | 96.09% |
| CHEMBL240 | Q12809 | HERG | 93.50% | 89.76% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.23% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.92% | 97.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.81% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.34% | 99.23% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.43% | 88.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.10% | 89.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.35% | 97.25% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.85% | 85.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.47% | 93.40% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.12% | 93.04% |
| CHEMBL4523377 | Q86WV6 | Stimulator of interferon genes protein | 82.95% | 95.48% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.57% | 96.25% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.02% | 94.62% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.48% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.88% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.83% | 90.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.63% | 94.75% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.39% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 196934 |
| LOTUS | LTS0094030 |
| wikiData | Q82909284 |