CID 181129
Internal ID | c7038190-3817-484a-a468-979b71d00ebd |
Taxonomy | Benzenoids > Phenols > Methoxyphenols > Shogaols |
IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one |
SMILES (Canonical) | CCCCCCCC=CC(=O)CCC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCCC=CC(=O)CCC1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C19H28O3/c1-3-4-5-6-7-8-9-10-17(20)13-11-16-12-14-18(21)19(15-16)22-2/h9-10,12,14-15,21H,3-8,11,13H2,1-2H3 |
InChI Key | LGZSMXJRMTYABD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H28O3 |
Molecular Weight | 304.40 g/mol |
Exact Mass | 304.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.80 |
FT-0775634 |
B0005-465778 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.01% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.04% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.54% | 92.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.16% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.76% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.50% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.45% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.67% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.99% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.93% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 84.77% | 98.75% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.60% | 95.50% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.62% | 90.20% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.55% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.89% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 181129 |
LOTUS | LTS0019883 |
wikiData | Q105151658 |