CID 162933246
Internal ID | b957b983-f7c0-4986-ac63-88a6356e7d75 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | |
SMILES (Canonical) | CC1CC2(C(C(C(=O)O2)C)O)OC13CCC4(C3(CCC5=C4CCC6C5(CCC(C6(C)CO)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(C(O1)C)O)O)O)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@@H]1C[C@]2([C@H]([C@H](C(=O)O2)C)O)O[C@@]13CC[C@@]4([C@@]3(CCC5=C4CC[C@@H]6[C@@]5(CC[C@@H]([C@]6(C)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@H](CO8)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)O)O)O)C)C)C |
InChI | InChI=1S/C53H84O24/c1-21-16-53(42(66)22(2)43(67)76-53)77-52(21)15-14-50(6)25-8-9-29-48(4,24(25)10-13-51(50,52)7)12-11-30(49(29,5)20-55)73-45-39(65)36(62)34(60)28(72-45)19-69-46-40(32(58)26(56)18-68-46)75-47-41(37(63)33(59)27(17-54)71-47)74-44-38(64)35(61)31(57)23(3)70-44/h21-23,26-42,44-47,54-66H,8-20H2,1-7H3/t21-,22-,23+,26+,27-,28-,29-,30+,31+,32+,33-,34-,35-,36+,37+,38-,39-,40-,41-,42+,44+,45+,46+,47+,48-,49-,50+,51+,52+,53-/m1/s1 |
InChI Key | BBOXNRHBNBEQDF-HDQUCJSWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H84O24 |
Molecular Weight | 1105.20 g/mol |
Exact Mass | 1104.53525354 g/mol |
Topological Polar Surface Area (TPSA) | 372.00 Ų |
XlogP | -2.60 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.11% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.76% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.16% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.88% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.87% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.77% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.29% | 94.75% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.21% | 97.36% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.46% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.16% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 89.87% | 96.43% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.62% | 95.50% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.99% | 95.38% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.18% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.81% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.09% | 86.33% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.11% | 96.61% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.85% | 86.92% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.57% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.31% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.22% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.57% | 95.83% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.72% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.14% | 97.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.06% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.66% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scilla luciliae |
PubChem | 162933246 |
LOTUS | LTS0220553 |
wikiData | Q104922905 |