CID 16174844
Internal ID | 7ac48086-f4d5-40cc-a4f5-679d6a0d8049 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3OC4=C(C(=C5C(=C4)C(=O)OCC(C(OC(=O)C6=CC(=C(C(=C65)O)O)O)C7C8C(C9=C(C(=C(C(=C9C(=O)O8)C2=C(C(=C(C=C2C(=O)O7)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3OC4=C(C(=C5C(=C4)C(=O)OC[C@H]([C@@H](OC(=O)C6=CC(=C(C(=C65)O)O)O)[C@H]7[C@@H]8[C@@H](C9=C(C(=C(C(=C9C(=O)O8)C2=C(C(=C(C=C2C(=O)O7)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)O)O)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2)O)O)O)OC(=O)C2=CC(=C(C(=C2C2=C(C(=C(C=C2C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C82H56O52/c83-24-1-15(2-25(84)46(24)94)72(113)126-36-13-123-76(117)22-12-35(54(102)59(107)41(22)40-20(9-32(91)51(99)57(40)105)77(118)128-66(36)69-68-62(110)45-44(81(122)130-68)43(60(108)63(111)61(45)109)42-21(79(120)132-69)10-33(92)52(100)58(42)106)125-65-23(11-34(93)53(101)64(65)112)80(121)134-82-71(133-74(115)17-5-28(87)48(96)29(88)6-17)70(131-73(114)16-3-26(85)47(95)27(86)4-16)67-37(127-82)14-124-75(116)18-7-30(89)49(97)55(103)38(18)39-19(78(119)129-67)8-31(90)50(98)56(39)104/h1-12,36-37,62,66-71,82-112H,13-14H2/t36-,37-,62-,66-,67-,68+,69+,70+,71-,82+/m1/s1 |
InChI Key | BHQDJISOPBGAEN-PLYKUFPTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C82H56O52 |
Molecular Weight | 1873.30 g/mol |
Exact Mass | 1872.1737620 g/mol |
Topological Polar Surface Area (TPSA) | 888.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 97.57% | 83.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.54% | 95.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.18% | 91.49% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.22% | 97.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.85% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.65% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.01% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.98% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.94% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 89.78% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.47% | 95.56% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.70% | 94.42% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.69% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.49% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 87.79% | 98.75% |
CHEMBL3194 | P02766 | Transthyretin | 87.50% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.15% | 85.14% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 86.79% | 97.53% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.56% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 86.10% | 98.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.50% | 95.78% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.28% | 96.38% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.20% | 83.57% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.18% | 97.09% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 83.86% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.03% | 94.73% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.37% | 95.56% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 82.32% | 100.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.56% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.02% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Corylus heterophylla |
PubChem | 16174844 |
LOTUS | LTS0087332 |
wikiData | Q104936171 |