CID 16174448
Internal ID | cbc05234-5c9f-4219-b9af-995dbeb9263a |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C8=C(C=C7C(=O)O1)OC9=C(C(=C(C=C9C(=O)O8)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C8=C(C=C7C(=O)O1)OC9=C(C(=C(C=C9C(=O)O8)O)O)O)O)O)O)O |
InChI | InChI=1S/C48H32O30/c49-17-1-11(2-18(50)29(17)57)42(65)76-40-39-26(73-48(78-44(67)13-5-21(53)31(59)22(54)6-13)41(40)77-43(66)12-3-19(51)30(58)20(52)4-12)10-71-45(68)15-9-25-38(74-47(70)16-8-24(56)33(61)36(64)37(16)72-25)35(63)28(15)27-14(46(69)75-39)7-23(55)32(60)34(27)62/h1-9,26,39-41,48-64H,10H2/t26-,39-,40+,41-,48+/m1/s1 |
InChI Key | VCWZZBZQRXILFR-DQLQDYHGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H32O30 |
Molecular Weight | 1088.70 g/mol |
Exact Mass | 1088.09783960 g/mol |
Topological Polar Surface Area (TPSA) | 500.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.40% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.61% | 83.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.96% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.47% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.70% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.58% | 99.23% |
CHEMBL2581 | P07339 | Cathepsin D | 89.53% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.32% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.96% | 90.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.23% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.29% | 94.73% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.90% | 93.40% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.43% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.61% | 85.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.93% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.33% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.21% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.78% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia prostrata |
PubChem | 16174448 |
LOTUS | LTS0041115 |
wikiData | Q105284013 |