CID 14557360
Internal ID | 6c329e8e-7fdd-46f5-97d9-461ccb312d53 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6aS,7R,12aR)-2,3,10-trimethoxy-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromen-7-ol |
SMILES (Canonical) | COC1=CC2=C(C=C1)C(C3C(O2)C4=CC(=C(C=C4CO3)OC)OC)O |
SMILES (Isomeric) | COC1=CC2=C(C=C1)[C@H]([C@H]3[C@H](O2)C4=CC(=C(C=C4CO3)OC)OC)O |
InChI | InChI=1S/C19H20O6/c1-21-11-4-5-12-14(7-11)25-18-13-8-16(23-3)15(22-2)6-10(13)9-24-19(18)17(12)20/h4-8,17-20H,9H2,1-3H3/t17-,18-,19+/m1/s1 |
InChI Key | UCNJXLRYQKOCTB-QRVBRYPASA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 66.40 Ų |
XlogP | 1.70 |
(6aS,7R,12aR)-2,3,10-trimethoxy-5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromen-7-ol |
(6aS)-5,6aalpha,7,12abeta-Tetrahydro-2,3,10-trimethoxy[2]benzopyrano[4,3-b][1]benzopyran-7alpha-ol |
![2D Structure of CID 14557360 2D Structure of CID 14557360](https://plantaedb.com/storage/docs/compounds/2023/11/cid-14557360.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.60% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.93% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.78% | 93.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.00% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.99% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.55% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 87.33% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.09% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.58% | 92.94% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.33% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.17% | 94.00% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 85.15% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.96% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.90% | 91.07% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.88% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia carneorum |
Acacia fasciculifera |
PubChem | 14557360 |
LOTUS | LTS0219434 |
wikiData | Q105270011 |