CID 14194059
Internal ID | d5eb8e43-04ce-4b7a-8fb2-f6f7b638a329 |
Taxonomy | Alkaloids and derivatives > Cularin alkaloids and derivatives |
IUPAC Name | (10S)-5,17-dimethoxy-11-methyl-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaen-6-ol |
SMILES (Canonical) | CN1CCC2=C3C1CC4=CC(=C(C=C4OC3=C(C=C2)OC)OC)O |
SMILES (Isomeric) | CN1CCC2=C3[C@@H]1CC4=CC(=C(C=C4OC3=C(C=C2)OC)OC)O |
InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-4-5-15(22-2)19-18(11)13(20)8-12-9-14(21)17(23-3)10-16(12)24-19/h4-5,9-10,13,21H,6-8H2,1-3H3/t13-/m0/s1 |
InChI Key | AYHLVGRPZNWNGK-ZDUSSCGKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H21NO4 |
Molecular Weight | 327.40 g/mol |
Exact Mass | 327.14705815 g/mol |
Topological Polar Surface Area (TPSA) | 51.20 Ų |
XlogP | 3.00 |
(10S)-5,17-Dimethoxy-11-methyl-2-oxa-11-azatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,14(18),15-hexaen-6-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 96.04% | 95.62% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.80% | 93.40% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.13% | 91.11% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.76% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.30% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.61% | 85.14% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.88% | 91.79% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.86% | 91.00% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 89.75% | 96.76% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.75% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.44% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.37% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.84% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 86.56% | 98.95% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 85.82% | 90.95% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.75% | 95.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.42% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 84.33% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.75% | 90.00% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.67% | 91.03% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.67% | 93.65% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.82% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.62% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.58% | 99.17% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 80.22% | 95.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sarcocapnos baetica |
Sarcocapnos crassifolia |
Sarcocapnos enneaphylla |
PubChem | 14194059 |
LOTUS | LTS0276113 |
wikiData | Q104397045 |