CID 14163582
Internal ID | c54b10bd-820b-4597-ab81-9d4224614bc3 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | |
SMILES (Canonical) | CC1CC(C2(C(C13CC(OC3=O)C4=COC=C4)CCCC25CO5)CO)OC(=O)C |
SMILES (Isomeric) | CC1CC(C2(C(C13CC(OC3=O)C4=COC=C4)CCCC25CO5)CO)OC(=O)C |
InChI | InChI=1S/C22H28O7/c1-13-8-18(28-14(2)24)22(11-23)17(4-3-6-20(22)12-27-20)21(13)9-16(29-19(21)25)15-5-7-26-10-15/h5,7,10,13,16-18,23H,3-4,6,8-9,11-12H2,1-2H3 |
InChI Key | VBPDFHXDMUNMDH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O7 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 98.50 Ų |
XlogP | 1.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.96% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.42% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.64% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.27% | 90.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.25% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.45% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.55% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.78% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.16% | 89.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.63% | 94.80% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.57% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 83.57% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.32% | 92.62% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.29% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.05% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.64% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.34% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.60% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.48% | 92.50% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.41% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Teucrium lamiifolium |
PubChem | 14163582 |
LOTUS | LTS0164721 |
wikiData | Q105283396 |