CID 13985870
| Internal ID | cfd79469-e160-44b3-8639-aa9c6fd19d0d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Amino acids and derivatives > Beta amino acids and derivatives |
| IUPAC Name | 3,6-diamino-N-(aminomethyl)hexanamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C7H18N4O/c8-3-1-2-6(10)4-7(12)11-5-9/h6H,1-5,8-10H2,(H,11,12) |
| InChI Key | CRSXNVVRUNDJIA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C7H18N4O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14806121 g/mol |
| Topological Polar Surface Area (TPSA) | 107.00 Ų |
| XlogP | -2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.09% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.26% | 91.11% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.19% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.27% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.34% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.10% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.72% | 99.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.23% | 93.18% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.84% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.96% | 94.45% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.08% | 90.20% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 82.98% | 100.00% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 81.67% | 96.28% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.03% | 95.17% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.95% | 94.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.83% | 96.47% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.77% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13985870 |
| LOTUS | LTS0051669 |
| wikiData | Q103817983 |