CID 134715250
Internal ID | 60e718ef-77d3-4bea-bf76-0ca92b6f7ac8 |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | [(1R,2S,3S,5S,8S,10S,11R,13R)-8-(furan-3-yl)-10-methyl-6,15-dioxo-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadecan-3-yl] acetate |
SMILES (Canonical) | CC(=O)OC1CC2C(=O)OC(CC2(C3C1C4CC(C3)OC4=O)C)C5=COC=C5 |
SMILES (Isomeric) | CC(=O)O[C@H]1C[C@@H]2C(=O)O[C@@H](C[C@]2([C@H]3[C@H]1[C@H]4C[C@@H](C3)OC4=O)C)C5=COC=C5 |
InChI | InChI=1S/C21H24O7/c1-10(22)26-16-7-15-20(24)28-17(11-3-4-25-9-11)8-21(15,2)14-6-12-5-13(18(14)16)19(23)27-12/h3-4,9,12-18H,5-8H2,1-2H3/t12-,13+,14+,15+,16-,17-,18+,21-/m0/s1 |
InChI Key | DYSOIAQEKRDXRB-GFTCARDDSA-N |
Popularity | 15 references in papers |
Molecular Formula | C21H24O7 |
Molecular Weight | 388.40 g/mol |
Exact Mass | 388.15220310 g/mol |
Topological Polar Surface Area (TPSA) | 92.00 Ų |
XlogP | 2.20 |
91095-48-6 |
CHEBI:175936 |
[(1R,2S,3S,5S,8S,10S,11R,13R)-8-(furan-3-yl)-10-methyl-6,15-dioxo-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadecan-3-yl] acetate |
[(1R,2S,3S,5S,8S,10S,11R,13R)-8-(uran-3-yl)-10-methyl-6,15-dioxo-7,14-dioxatetracyclo[11.2.1.02,11.05,10]hexadecan-3-yl] acetate |
![2D Structure of CID 134715250 2D Structure of CID 134715250](https://plantaedb.com/storage/docs/compounds/2023/11/cid-134715250.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.06% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.83% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.46% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.41% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.99% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.98% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.93% | 97.25% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.31% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.28% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.55% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.78% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.10% | 94.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.04% | 90.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.31% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.55% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea bulbifera |
PubChem | 134715250 |
LOTUS | LTS0096718 |
wikiData | Q104991552 |