Taxuspine X
Internal ID | 70133f6d-9a64-4cdc-ae7b-5fa2a7bd2cef |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [(1R,2S,3E,5S,7S,8Z,10R,13S)-2,7,9,10,13-pentaacetyloxy-4-(acetyloxymethyl)-8,12,15,15-tetramethyl-5-bicyclo[9.3.1]pentadeca-3,8,11-trienyl] (E)-3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=C2C(C(=C(C(CC(C(=CC(C(C2(C)C)CC1OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C=CC3=CC=CC=C3)OC(=O)C)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2[C@H](/C(=C(/[C@H](C[C@@H](/C(=C/[C@@H]([C@@H](C2(C)C)C[C@@H]1OC(=O)C)OC(=O)C)/COC(=O)C)OC(=O)/C=C/C3=CC=CC=C3)OC(=O)C)\C)/OC(=O)C)OC(=O)C |
InChI | InChI=1S/C41H50O14/c1-22-33(50-25(4)43)19-32-36(52-27(6)45)18-31(21-49-24(3)42)35(55-37(48)17-16-30-14-12-11-13-15-30)20-34(51-26(5)44)23(2)39(53-28(7)46)40(54-29(8)47)38(22)41(32,9)10/h11-18,32-36,40H,19-21H2,1-10H3/b17-16+,31-18+,39-23-/t32-,33-,34-,35-,36-,40+/m0/s1 |
InChI Key | FLBNRACKRBUYNP-AHLSXCLRSA-N |
Popularity | 3 references in papers |
Molecular Formula | C41H50O14 |
Molecular Weight | 766.80 g/mol |
Exact Mass | 766.32005626 g/mol |
Topological Polar Surface Area (TPSA) | 184.00 Ų |
XlogP | 3.20 |
194782-02-0 |
[(1R,2S,3E,5S,7S,8Z,10R,13S)-2,7,9,10,13-Pentaacetyloxy-4-(acetyloxymethyl)-8,12,15,15-tetramethyl-5-bicyclo[9.3.1]pentadeca-3,8,11-trienyl] (E)-3-phenylprop-2-enoate |
AKOS040762415 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.38% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.74% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.35% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.79% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.42% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.70% | 95.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.96% | 90.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.87% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.66% | 98.95% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 86.51% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.30% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.97% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.30% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.86% | 91.71% |
CHEMBL5028 | O14672 | ADAM10 | 84.01% | 97.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.56% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.84% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.00% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus cuspidata |
Taxus mairei |
Taxus wallichiana var. chinensis |
PubChem | 124511126 |
LOTUS | LTS0238068 |
wikiData | Q104996909 |