CID 12082288
Internal ID | 07f87264-df95-443f-bcdc-4b7919e55707 |
Taxonomy | Alkaloids and derivatives > Melodinus alkaloids |
IUPAC Name | methyl (1S,10R,12S,19S)-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
SMILES (Canonical) | COC(=O)C12CC3(C=CCN4C3C1(CC4)C5=CC=CC=C5NC2=O)C=C |
SMILES (Isomeric) | COC(=O)[C@]12C[C@@]3(C=CCN4[C@@H]3[C@@]1(CC4)C5=CC=CC=C5NC2=O)C=C |
InChI | InChI=1S/C21H22N2O3/c1-3-19-9-6-11-23-12-10-20(16(19)23)14-7-4-5-8-15(14)22-17(24)21(20,13-19)18(25)26-2/h3-9,16H,1,10-13H2,2H3,(H,22,24)/t16-,19-,20+,21+/m0/s1 |
InChI Key | JTSSMMKHJYRYEG-VRXWPRPYSA-N |
Popularity | 8 references in papers |
Molecular Formula | C21H22N2O3 |
Molecular Weight | 350.40 g/mol |
Exact Mass | 350.16304257 g/mol |
Topological Polar Surface Area (TPSA) | 58.60 Ų |
XlogP | 2.50 |
24314-59-8 |
(+)-Scandine;Sandine |
HY-N1248 |
AKOS040762305 |
FS-9644 |
CS-0016651 |
methyl (1S,10R,12S,19S)-12-ethenyl-9-oxo-8,16-diazapentacyclo[10.6.1.01,10.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.62% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.13% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.07% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 95.52% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.22% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 93.55% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.48% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.28% | 86.33% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.98% | 93.03% |
CHEMBL5028 | O14672 | ADAM10 | 84.96% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.12% | 94.08% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.34% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Melodinus tenuicaudatus |
PubChem | 12082288 |
LOTUS | LTS0077662 |
wikiData | Q105134976 |