CID 10767841
Internal ID | cd2ab8b4-87de-487b-93a6-0aa73fff738e |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 4-hydroxy-17-methoxy-16-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one |
SMILES (Canonical) | COC1=C2C=CC(=C1OC3C(C(C(C(O3)CO)O)O)O)CCCCC(=O)CCC4=CC(=C(C=C4)O)O2 |
SMILES (Isomeric) | COC1=C2C=CC(=C1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CCCCC(=O)CCC4=CC(=C(C=C4)O)O2 |
InChI | InChI=1S/C26H32O10/c1-33-25-18-11-8-15(24(25)36-26-23(32)22(31)21(30)20(13-27)35-26)4-2-3-5-16(28)9-6-14-7-10-17(29)19(12-14)34-18/h7-8,10-12,20-23,26-27,29-32H,2-6,9,13H2,1H3/t20-,21-,22+,23-,26+/m1/s1 |
InChI Key | RALVCBWUWHJOGL-OPMJLWCUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O10 |
Molecular Weight | 504.50 g/mol |
Exact Mass | 504.19954721 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 1.80 |
CHEBI:172719 |
DTXSID201106455 |
191999-61-8 |
2-Oxatricyclo[13.2.2.13,7]eicosa-3,5,7(20),15,17,18-hexaen-10-one, 16-(beta-D-glucopyranosyloxy)-4-hydroxy-17-methoxy- |
4-hydroxy-17-methoxy-16-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3,5,7(20),15,18-hexaen-10-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.89% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 96.53% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.18% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.77% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.56% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.32% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.28% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.75% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.44% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.14% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.24% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.19% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.74% | 92.62% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.16% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.97% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 83.63% | 98.75% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.68% | 82.67% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.05% | 95.83% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.15% | 99.15% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.04% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrica gale |
PubChem | 10767841 |
LOTUS | LTS0221264 |
wikiData | Q105232695 |