2-Hydroxy-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one
| Internal ID | 87d0f2f3-62ee-48fc-9878-fcf2b02c3c74 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | 2-hydroxy-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO3/c1-8(2)15(18)14(17)11-5-4-10-6-9(3)16-7-12(10)13(11)19-15/h4-8,18H,1-3H3 |
| InChI Key | CYCJFMKXQPLWCL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 59.40 Ų |
| XlogP | 2.70 |
| 250231-82-4 |
| 2-hydroxy-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one |
| orb2279414 |
| SCHEMBL29767813 |
| EX-A13920 |
| AKOS040735210 |
| T125205 |
| 2-Hydroxy-2-isopropyl-7-methylfuro[3,2-h]isoquinolin-3(2H)-one |
![2D Structure of 2-Hydroxy-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/cid-10467646.jpg "2D Structure of 2-Hydroxy-7-methyl-2-propan-2-ylfuro[3,2-h]isoquinolin-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.38% | 83.82% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.40% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.74% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.86% | 94.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.18% | 93.10% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.37% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 90.29% | 93.65% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.68% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.12% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.11% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.01% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.62% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.71% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.78% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.57% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.12% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.29% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.66% | 100.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.60% | 96.67% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.11% | 99.15% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.80% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10467646 |
| LOTUS | LTS0069303 |
| wikiData | Q103818165 |