CID 101685531
Internal ID | 87e6b138-7985-4d4e-996a-6e879c78d7bf |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | |
SMILES (Canonical) | CC(=O)OC1(C(=O)CC2C(CCCC2(C13CCC4(O3)CC(=O)OC4)C)(C)C)C |
SMILES (Isomeric) | CC(=O)O[C@]1(C(=O)C[C@@H]2[C@@]([C@@]13CC[C@@]4(O3)CC(=O)OC4)(CCCC2(C)C)C)C |
InChI | InChI=1S/C22H32O6/c1-14(23)27-20(5)16(24)11-15-18(2,3)7-6-8-19(15,4)22(20)10-9-21(28-22)12-17(25)26-13-21/h15H,6-13H2,1-5H3/t15-,19-,20-,21+,22-/m0/s1 |
InChI Key | RQLCYKFHKADHTG-MBDOPNELSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H32O6 |
Molecular Weight | 392.50 g/mol |
Exact Mass | 392.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 78.90 Ų |
XlogP | 2.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.37% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.74% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 91.34% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.73% | 99.23% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.28% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.93% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.31% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.32% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.89% | 97.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.10% | 94.75% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.77% | 93.04% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.27% | 96.77% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.17% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.82% | 82.69% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.73% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.47% | 94.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.40% | 91.19% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.02% | 89.00% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.58% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonurus persicus |
PubChem | 101685531 |
LOTUS | LTS0201321 |
wikiData | Q105243377 |