CID 101268543
Internal ID | 642c0192-7d83-4d80-b9ce-c4ae7265da51 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
IUPAC Name | |
SMILES (Canonical) | CC1CC2(C(C(C(=O)O2)C)O)OC13CCC4(C3(CCC5=C4CCC6C5(CCC(C6(C)CO)OC7C(C(C(C(O7)COC8C(C(C(CO8)O)O)OC9C(C(C(C(O9)CO)O)OC1C(C(C(CO1)O)O)OC1C(C(C(O1)CO)O)O)OC1C(C(C(C(O1)C)O)O)O)O)O)O)C)C)C |
SMILES (Isomeric) | C[C@@H]1C[C@]2(C([C@H](C(=O)O2)C)O)O[C@@]13CC[C@@]4([C@@]3(CCC5=C4CC[C@@H]6[C@@]5(CC[C@@H]([C@]6(C)CO)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO[C@H]8[C@@H]([C@H]([C@H](CO8)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O[C@H]1[C@@H]([C@H]([C@H](CO1)O)O)O[C@H]1[C@@H]([C@H]([C@@H](O1)CO)O)O)O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O)O)O)O)O)C)C)C |
InChI | InChI=1S/C63H100O32/c1-23-16-63(50(80)24(2)51(81)94-63)95-62(23)15-14-60(6)27-8-9-33-58(4,26(27)10-13-61(60,62)7)12-11-34(59(33,5)22-66)89-53-45(79)42(76)39(73)32(88-53)21-84-55-47(36(70)28(67)19-82-55)92-57-49(93-52-44(78)41(75)35(69)25(3)85-52)46(40(74)31(18-65)87-57)90-56-48(37(71)29(68)20-83-56)91-54-43(77)38(72)30(17-64)86-54/h23-25,28-50,52-57,64-80H,8-22H2,1-7H3/t23-,24-,25+,28+,29+,30+,31-,32-,33-,34+,35+,36+,37+,38+,39-,40-,41-,42+,43-,44-,45-,46+,47-,48-,49-,50?,52+,53+,54+,55+,56+,57+,58-,59-,60+,61+,62+,63-/m1/s1 |
InChI Key | XLCIAIDGRAPISZ-CXCBYVENSA-N |
Popularity | 0 references in papers |
Molecular Formula | C63H100O32 |
Molecular Weight | 1369.40 g/mol |
Exact Mass | 1368.6197710 g/mol |
Topological Polar Surface Area (TPSA) | 490.00 Ų |
XlogP | -5.10 |
There are no found synonyms. |
![2D Structure of CID 101268543 2D Structure of CID 101268543](https://plantaedb.com/storage/docs/compounds/2023/11/cid-101268543.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.85% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.17% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.67% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.70% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.38% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.26% | 95.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.00% | 94.75% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.85% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.84% | 89.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.64% | 95.38% |
CHEMBL1871 | P10275 | Androgen Receptor | 88.13% | 96.43% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.05% | 91.49% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.48% | 95.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.81% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.56% | 94.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.44% | 91.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.22% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.27% | 86.92% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.41% | 93.04% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.31% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.22% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.57% | 95.83% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.72% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.28% | 92.50% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.16% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bellevalia paradoxa |
PubChem | 101268543 |
LOTUS | LTS0117180 |
wikiData | Q105329878 |