Cichorioside F
Internal ID | 59dc1667-6ed9-4ed1-81af-0d2395a39963 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > C-glycosyl compounds |
IUPAC Name | (3S,3aR,4S,9aS,9bR)-9-[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxymethyl]-4-hydroxy-3,6-dimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
SMILES (Canonical) | CC1C2C(CC(=C3C(C2OC1=O)C(=CC3=O)COC4(C(C(C(O4)CO)O)O)CO)C)O |
SMILES (Isomeric) | C[C@H]1[C@@H]2[C@H](CC(=C3[C@@H]([C@H]2OC1=O)C(=CC3=O)CO[C@]4([C@H]([C@@H]([C@H](O4)CO)O)O)CO)C)O |
InChI | InChI=1S/C21H28O10/c1-8-3-11(24)15-9(2)20(28)30-18(15)16-10(4-12(25)14(8)16)6-29-21(7-23)19(27)17(26)13(5-22)31-21/h4,9,11,13,15-19,22-24,26-27H,3,5-7H2,1-2H3/t9-,11-,13+,15+,16-,17+,18-,19-,21+/m0/s1 |
InChI Key | VPJIBVRZDKWNNF-YHMCHQIZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O10 |
Molecular Weight | 440.40 g/mol |
Exact Mass | 440.16824709 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -1.90 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.16% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.27% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.61% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 93.11% | 94.80% |
CHEMBL2581 | P07339 | Cathepsin D | 92.71% | 98.95% |
CHEMBL4072 | P07858 | Cathepsin B | 89.72% | 93.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.22% | 94.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.17% | 89.63% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.15% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.43% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.28% | 96.61% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.07% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.98% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.32% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.85% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.28% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cichorium endivia |
PubChem | 102476813 |
LOTUS | LTS0205181 |
wikiData | Q105290818 |