Cibarin
Internal ID | 9e2f9f12-6ac1-4bd0-8b52-91e9aa1a840a |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides |
IUPAC Name | [3,4,5-trihydroxy-6-(3-nitropropanoyloxy)oxan-2-yl]methyl 3-nitropropanoate |
SMILES (Canonical) | C(C[N+](=O)[O-])C(=O)OCC1C(C(C(C(O1)OC(=O)CC[N+](=O)[O-])O)O)O |
SMILES (Isomeric) | C(C[N+](=O)[O-])C(=O)OCC1C(C(C(C(O1)OC(=O)CC[N+](=O)[O-])O)O)O |
InChI | InChI=1S/C12H18N2O12/c15-7(1-3-13(20)21)24-5-6-9(17)10(18)11(19)12(25-6)26-8(16)2-4-14(22)23/h6,9-12,17-19H,1-5H2 |
InChI Key | PUSAAHYGRLPDMQ-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C12H18N2O12 |
Molecular Weight | 382.28 g/mol |
Exact Mass | 382.08597401 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | -2.50 |
Cibarin |
C12H18N2O12 |
DTXSID10960363 |
NSC-279516 |
1,6-Bis-O-(3-nitropropanoyl)hexopyranose |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.77% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.26% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.99% | 91.11% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.38% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.99% | 94.73% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.58% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.47% | 92.50% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 83.46% | 83.82% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.38% | 86.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.31% | 94.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.80% | 94.80% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.54% | 95.64% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.30% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astragalus cibarius |
Conioselinum anthriscoides |
Curcuma aromatica |
Ephedra equisetina |
Ephedra sinica |