Chrysoxanthone
| Internal ID | eff599e2-1582-40fa-aff3-40e097a902a1 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | methyl 5,7-dichloro-2,3,8-trihydroxy-6-methyl-9-oxoxanthene-1-carboxylate |
| SMILES (Canonical) | CC1=C(C(=C2C(=C1Cl)OC3=C(C2=O)C(=C(C(=C3)O)O)C(=O)OC)O)Cl |
| SMILES (Isomeric) | CC1=C(C(=C2C(=C1Cl)OC3=C(C2=O)C(=C(C(=C3)O)O)C(=O)OC)O)Cl |
| InChI | InChI=1S/C16H10Cl2O7/c1-4-10(17)14(22)9-13(21)7-6(25-15(9)11(4)18)3-5(19)12(20)8(7)16(23)24-2/h3,19-20,22H,1-2H3 |
| InChI Key | FSLHHSPNMZXVAD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H10Cl2O7 |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 383.9803580 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | 4.50 |
| CHEMBL5282953 |
| CHEBI:217333 |
| BDBM50611926 |
| methyl 5,7-dichloro-2,3,8-trihydroxy-6-methyl-9-oxoxanthene-1-carboxylate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.01% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.37% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.12% | 94.73% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 91.08% | 94.42% |
| CHEMBL3194 | P02766 | Transthyretin | 89.69% | 90.71% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.55% | 81.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.68% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.78% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.50% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.33% | 89.34% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.51% | 86.33% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.37% | 93.65% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.32% | 99.15% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.16% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684278 |
| LOTUS | LTS0157329 |
| wikiData | Q105000712 |