Chrysaibol
| Internal ID | e04d2b09-7c80-49b2-b748-326de7a3dd81 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-N-[(2S)-1-hydroxypropan-2-yl]pentanediamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CCC(=O)N)C(=O)NC(C)CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC2=CNC3=CC=CC=C32)NC(=O)C |
| SMILES (Isomeric) | C[C@@H](CO)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H]1CCCN1C(=O)C(C)(C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)[C@H](CC2=CNC3=CC=CC=C32)NC(=O)C |
| InChI | InChI=1S/C77H125N19O19/c1-39(2)34-50(88-67(111)73(11,12)93-68(112)75(15,16)91-63(107)52(83-43(8)98)36-44-37-81-46-25-22-21-24-45(44)46)60(104)89-57(41(5)6)65(109)85-49(29-32-56(80)101)61(105)90-74(13,14)69(113)95-76(17,18)70(114)94-72(9,10)66(110)87-48(28-31-55(79)100)59(103)86-51(35-40(3)4)62(106)92-77(19,20)71(115)96-33-23-26-53(96)64(108)84-47(27-30-54(78)99)58(102)82-42(7)38-97/h21-22,24-25,37,39-42,47-53,57,81,97H,23,26-36,38H2,1-20H3,(H2,78,99)(H2,79,100)(H2,80,101)(H,82,102)(H,83,98)(H,84,108)(H,85,109)(H,86,103)(H,87,110)(H,88,111)(H,89,104)(H,90,105)(H,91,107)(H,92,106)(H,93,112)(H,94,114)(H,95,113)/t42-,47-,48-,49-,50-,51-,52-,53-,57-/m0/s1 |
| InChI Key | IPCNUNZLKUHWAZ-WGRFOCSXSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C77H125N19O19 |
| Molecular Weight | 1620.90 g/mol |
| Exact Mass | 1619.93991283 g/mol |
| Topological Polar Surface Area (TPSA) | 593.00 Ų |
| XlogP | -1.00 |
| Atomic LogP (AlogP) | -2.47 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 45 |
| CHEMBL504009 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8758 | 87.58% |
| Caco-2 | - | 0.8605 | 86.05% |
| Blood Brain Barrier | - | 0.6000 | 60.00% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Lysosomes | 0.4843 | 48.43% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8652 | 86.52% |
| OATP1B3 inhibitior | + | 0.9421 | 94.21% |
| MATE1 inhibitior | - | 0.7679 | 76.79% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9771 | 97.71% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8806 | 88.06% |
| CYP3A4 substrate | + | 0.7518 | 75.18% |
| CYP2C9 substrate | + | 0.5775 | 57.75% |
| CYP2D6 substrate | - | 0.8178 | 81.78% |
| CYP3A4 inhibition | + | 0.7469 | 74.69% |
| CYP2C9 inhibition | - | 0.7365 | 73.65% |
| CYP2C19 inhibition | - | 0.5585 | 55.85% |
| CYP2D6 inhibition | - | 0.8873 | 88.73% |
| CYP1A2 inhibition | - | 0.8307 | 83.07% |
| CYP2C8 inhibition | + | 0.6318 | 63.18% |
| CYP inhibitory promiscuity | - | 0.8135 | 81.35% |
| UGT catelyzed | + | 0.9000 | 90.00% |
| Carcinogenicity (binary) | - | 0.7700 | 77.00% |
| Carcinogenicity (trinary) | Non-required | 0.6239 | 62.39% |
| Eye corrosion | - | 0.9883 | 98.83% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7924 | 79.24% |
| Skin corrosion | - | 0.9179 | 91.79% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7202 | 72.02% |
| Micronuclear | + | 0.6600 | 66.00% |
| Hepatotoxicity | - | 0.5621 | 56.21% |
| skin sensitisation | - | 0.8815 | 88.15% |
| Respiratory toxicity | + | 0.9000 | 90.00% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.9375 | 93.75% |
| Nephrotoxicity | - | 0.7985 | 79.85% |
| Acute Oral Toxicity (c) | III | 0.6356 | 63.56% |
| Estrogen receptor binding | - | 0.5568 | 55.68% |
| Androgen receptor binding | + | 0.7067 | 70.67% |
| Thyroid receptor binding | + | 0.7669 | 76.69% |
| Glucocorticoid receptor binding | + | 0.8281 | 82.81% |
| Aromatase binding | + | 0.8126 | 81.26% |
| PPAR gamma | + | 0.7797 | 77.97% |
| Honey bee toxicity | - | 0.7554 | 75.54% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.6674 | 66.74% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.91% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.82% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.93% | 98.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.48% | 97.64% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 98.39% | 95.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.13% | 96.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.39% | 88.56% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 96.93% | 96.31% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 96.85% | 83.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.77% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.92% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.37% | 90.08% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.29% | 96.67% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.08% | 93.56% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.84% | 95.56% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 93.59% | 91.81% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 93.58% | 98.94% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 93.11% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.49% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.39% | 100.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.72% | 95.56% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 91.22% | 100.00% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 91.20% | 92.12% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 91.16% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.94% | 91.19% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.77% | 89.62% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.68% | 88.42% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.67% | 95.89% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 89.88% | 100.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.77% | 97.50% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.59% | 97.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.53% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.29% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 89.01% | 96.03% |
| CHEMBL5028 | O14672 | ADAM10 | 88.95% | 97.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 88.93% | 96.28% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 88.75% | 92.80% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 88.62% | 98.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.28% | 98.59% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.15% | 96.47% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.86% | 98.75% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 86.74% | 94.66% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 85.83% | 98.24% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.40% | 97.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.45% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.23% | 96.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.97% | 93.03% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 83.86% | 99.52% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 82.52% | 82.69% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 82.42% | 92.38% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.40% | 95.83% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.94% | 96.90% |
| CHEMBL4801 | P29466 | Caspase-1 | 81.78% | 96.85% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.76% | 97.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.49% | 98.05% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.00% | 93.67% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.77% | 82.86% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 80.76% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 25058082 |
| LOTUS | LTS0008948 |
| wikiData | Q75059723 |