Chrobisiamone A
Internal ID | 3872660c-8816-4a6c-9829-1d0a75cb4b65 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
IUPAC Name | 7-hydroxy-2-[[7-hydroxy-2-methyl-4-oxo-5-(2-oxopropyl)-3H-chromen-2-yl]methyl]-5-(2-oxopropyl)chromen-4-one |
SMILES (Canonical) | CC(=O)CC1=C2C(=O)CC(OC2=CC(=C1)O)(C)CC3=CC(=O)C4=C(C=C(C=C4O3)O)CC(=O)C |
SMILES (Isomeric) | CC(=O)CC1=C2C(=O)CC(OC2=CC(=C1)O)(C)CC3=CC(=O)C4=C(C=C(C=C4O3)O)CC(=O)C |
InChI | InChI=1S/C26H24O8/c1-13(27)4-15-6-17(29)8-22-24(15)20(31)10-19(33-22)11-26(3)12-21(32)25-16(5-14(2)28)7-18(30)9-23(25)34-26/h6-10,29-30H,4-5,11-12H2,1-3H3 |
InChI Key | GEBKTFOJHPZDJE-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H24O8 |
Molecular Weight | 464.50 g/mol |
Exact Mass | 464.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 1.70 |
CHEMBL457048 |
![2D Structure of Chrobisiamone A 2D Structure of Chrobisiamone A](https://plantaedb.com/storage/docs/compounds/2023/11/chrobisiamone-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.42% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.71% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.68% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.43% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.70% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.69% | 90.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.93% | 94.42% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.69% | 94.73% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.59% | 93.04% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.48% | 96.77% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.53% | 96.21% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.40% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.98% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.93% | 99.23% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.63% | 91.19% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.50% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.47% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senna siamea |
PubChem | 44561380 |
LOTUS | LTS0206256 |
wikiData | Q105007075 |