Chloranthalactone C
Internal ID | 4d410b0c-9010-41dc-99b7-35fd6e3c7a0a |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | [(1S,9S,10R,12S,13R)-4,9-dimethyl-5-oxo-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3,7-dien-13-yl]methyl acetate |
SMILES (Canonical) | CC1=C2CC3C(C4CC4C3(C=C2OC1=O)C)COC(=O)C |
SMILES (Isomeric) | CC1=C2C[C@H]3[C@@H]([C@H]4C[C@H]4[C@@]3(C=C2OC1=O)C)COC(=O)C |
InChI | InChI=1S/C17H20O4/c1-8-10-4-14-12(7-20-9(2)18)11-5-13(11)17(14,3)6-15(10)21-16(8)19/h6,11-14H,4-5,7H2,1-3H3/t11-,12-,13-,14+,17+/m1/s1 |
InChI Key | AFQYMJMJVURITP-MAKQCAJESA-N |
Popularity | 2 references in papers |
Molecular Formula | C17H20O4 |
Molecular Weight | 288.34 g/mol |
Exact Mass | 288.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 2.40 |
CHEMBL4165759 |
Q54806973 |
![2D Structure of Chloranthalactone C 2D Structure of Chloranthalactone C](https://plantaedb.com/storage/docs/compounds/2023/11/chloranthalactone-c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.59% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.88% | 85.14% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.43% | 96.95% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 91.30% | 97.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.05% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.38% | 97.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 89.35% | 94.80% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.83% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.74% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.37% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.55% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.49% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.75% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.56% | 89.00% |
CHEMBL5028 | O14672 | ADAM10 | 84.06% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.60% | 91.19% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.74% | 94.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.84% | 97.79% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.69% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus serratus |
PubChem | 14239912 |
LOTUS | LTS0123502 |
wikiData | Q54806973 |