Chivotriene
| Internal ID | 7aa79b53-8b27-4f87-bbe9-72edcba389db |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
| IUPAC Name | (5R,6E,8E,10Z,12S,13S,14S,15S,17R)-5,13,15,17-tetrahydroxy-12,14-dimethyloctadeca-6,8,10-trien-3-one |
| SMILES (Canonical) | CCC(=O)CC(C=CC=CC=CC(C)C(C(C)C(CC(C)O)O)O)O |
| SMILES (Isomeric) | CCC(=O)C[C@H](/C=C/C=C/C=C\[C@H](C)[C@@H]([C@@H](C)[C@H](C[C@@H](C)O)O)O)O |
| InChI | InChI=1S/C20H34O5/c1-5-17(22)13-18(23)11-9-7-6-8-10-14(2)20(25)16(4)19(24)12-15(3)21/h6-11,14-16,18-21,23-25H,5,12-13H2,1-4H3/b7-6+,10-8-,11-9+/t14-,15+,16-,18-,19-,20-/m0/s1 |
| InChI Key | PKZWOSPCXISENT-VJZSSXRISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24062418 g/mol |
| Topological Polar Surface Area (TPSA) | 98.00 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.50% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.45% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.49% | 90.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.21% | 97.21% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.67% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.53% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.06% | 93.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.90% | 96.95% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.75% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.08% | 98.75% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.62% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.26% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.70% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 49800146 |
| LOTUS | LTS0193545 |
| wikiData | Q77386016 |