Chandrananimycin A
| Internal ID | 0f5dc45f-e36e-4c94-a2f8-9baa946d02a9 |
| Taxonomy | Organoheterocyclic compounds > Benzoxazines > Phenoxazines |
| IUPAC Name | N-(9-hydroxy-3-oxophenoxazin-2-yl)acetamide |
| SMILES (Canonical) | CC(=O)NC1=CC2=NC3=C(C=CC=C3OC2=CC1=O)O |
| SMILES (Isomeric) | CC(=O)NC1=CC2=NC3=C(C=CC=C3OC2=CC1=O)O |
| InChI | InChI=1S/C14H10N2O4/c1-7(17)15-8-5-9-13(6-11(8)19)20-12-4-2-3-10(18)14(12)16-9/h2-6,18H,1H3,(H,15,17) |
| InChI Key | VRKDUDPRCAZBHW-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06405680 g/mol |
| Topological Polar Surface Area (TPSA) | 88.00 Ų |
| XlogP | 0.50 |
| CHEMBL2322651 |
| N-(9-hydroxy-3-oxophenoxazin-2-yl)acetamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3401 | O75469 | Pregnane X receptor | 97.64% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.41% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.23% | 99.23% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 95.67% | 81.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.40% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.57% | 98.95% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 92.17% | 89.49% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 90.91% | 87.67% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.88% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.51% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.17% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.21% | 86.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.18% | 83.82% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.22% | 99.15% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.80% | 85.30% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.28% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.08% | 93.65% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.36% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9993261 |
| LOTUS | LTS0047610 |
| wikiData | Q104199725 |