Chamaejasmenin B
Internal ID | d91ee9b6-6f59-4b0d-8a8c-528b2ba3b622 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | (2S,3S)-3-[(2S,3S)-5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2C(C(=O)C3=C(C=C(C=C3O2)O)O)C4C(OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)[C@@H]2[C@@H](C(=O)C3=C(C=C(C=C3O2)O)O)[C@H]4[C@H](OC5=CC(=CC(=C5C4=O)O)O)C6=CC=C(C=C6)OC |
InChI | InChI=1S/C32H26O10/c1-39-19-7-3-15(4-8-19)31-27(29(37)25-21(35)11-17(33)13-23(25)41-31)28-30(38)26-22(36)12-18(34)14-24(26)42-32(28)16-5-9-20(40-2)10-6-16/h3-14,27-28,31-36H,1-2H3/t27-,28-,31-,32-/m1/s1 |
InChI Key | BTCICADMSGBCKA-QWWQXMGCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H26O10 |
Molecular Weight | 570.50 g/mol |
Exact Mass | 570.15259702 g/mol |
Topological Polar Surface Area (TPSA) | 152.00 Ų |
XlogP | 5.30 |
89595-71-1 |
Chamaejasmenin A |
(2S,3S)-3-[(2S,3S)-5,7-dihydroxy-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]-5,7-dihydroxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
DTXSID50904842 |
HY-N7486 |
AKOS040761479 |
FS-7474 |
CS-0129945 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.88% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.33% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.90% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.41% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.39% | 96.09% |
CHEMBL240 | Q12809 | HERG | 91.37% | 89.76% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.69% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.88% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.34% | 97.09% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.55% | 96.12% |
CHEMBL2535 | P11166 | Glucose transporter | 87.43% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.66% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 85.65% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.99% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.58% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.56% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.43% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.91% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.34% | 85.14% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.12% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stellera chamaejasme |
Wikstroemia sikokiana |
PubChem | 21676273 |
LOTUS | LTS0136882 |
wikiData | Q82873518 |