[(1S,2S,3R,7S,8R,11S,12R,14R,15S,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate
| Internal ID | 76750649-8e2a-409f-ae5f-37478f38530a |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | [(1S,2S,3R,7S,8R,11S,12R,14R,15S,17S)-12-acetyloxy-15-hydroxy-4,8,11,15-tetramethyl-6-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-4-en-14-yl] acetate |
| SMILES (Canonical) | CC1COC2(C(CC(C(CC3C4C(C1C(=O)C=C4C)C2O3)(C)O)OC(=O)C)OC(=O)C)C |
| SMILES (Isomeric) | C[C@H]1CO[C@]2([C@@H](C[C@H]([C@@](C[C@H]3[C@@H]4[C@@H]([C@H]1C(=O)C=C4C)[C@@H]2O3)(C)O)OC(=O)C)OC(=O)C)C |
| InChI | InChI=1S/C24H34O8/c1-11-7-15(27)19-12(2)10-29-24(6)18(31-14(4)26)8-17(30-13(3)25)23(5,28)9-16-20(11)21(19)22(24)32-16/h7,12,16-22,28H,8-10H2,1-6H3/t12-,16-,17+,18+,19+,20+,21+,22-,23-,24-/m0/s1 |
| InChI Key | YIAHINSGOBHTRP-UFNZTCFCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.22536804 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.25% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.30% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.20% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.44% | 92.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.05% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.21% | 89.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.03% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.92% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.50% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.82% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.25% | 93.04% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.02% | 94.42% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.16% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.15% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.98% | 90.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.29% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162941869 |
| LOTUS | LTS0079523 |
| wikiData | Q105348703 |