(1S,2S,3'S,4S,4'S,6S,7R,8R,9S,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-7-(hydroxymethyl)-9,13-dimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol
Internal ID | 0f38b72e-c05c-4614-b07d-71936c9ddc6f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1S,2S,3'S,4S,4'S,6S,7R,8R,9S,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-7-(hydroxymethyl)-9,13-dimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3CC(CC4=CCC5C(C34C)CCC6(C5CC7C6C(C8(O7)C(C(C(=C)CO8)O)O)CO)C)O)CO)O)OC9C(C(C(CO9)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@@H]3C[C@@H](CC4=CC[C@@H]5[C@@H]([C@@]34C)CC[C@]6([C@H]5C[C@H]7[C@@H]6[C@@H]([C@]8(O7)[C@H]([C@H](C(=C)CO8)O)O)CO)C)O)CO)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O)O |
InChI | InChI=1S/C44H68O20/c1-16-14-58-44(38(56)29(16)49)23(12-45)28-25(64-44)11-22-20-6-5-18-9-19(47)10-27(43(18,4)21(20)7-8-42(22,28)3)61-41-37(63-40-35(55)33(53)30(50)17(2)59-40)36(32(52)26(13-46)60-41)62-39-34(54)31(51)24(48)15-57-39/h5,17,19-41,45-56H,1,6-15H2,2-4H3/t17-,19+,20+,21-,22-,23-,24+,25-,26+,27+,28-,29-,30-,31-,32+,33+,34+,35+,36-,37+,38-,39-,40-,41-,42-,43-,44-/m0/s1 |
InChI Key | OPNGLCCEIUOGGX-MCTUCHJISA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H68O20 |
Molecular Weight | 917.00 g/mol |
Exact Mass | 916.43039455 g/mol |
Topological Polar Surface Area (TPSA) | 317.00 Ų |
XlogP | -3.50 |
There are no found synonyms. |
![2D Structure of (1S,2S,3'S,4S,4'S,6S,7R,8R,9S,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-7-(hydroxymethyl)-9,13-dimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol 2D Structure of (1S,2S,3'S,4S,4'S,6S,7R,8R,9S,12S,13R,14R,16R)-14-[(2R,3R,4S,5R,6R)-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-7-(hydroxymethyl)-9,13-dimethyl-5'-methylidenespiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-3',4',16-triol](https://plantaedb.com/storage/docs/compounds/2023/11/cffa4290-845b-11ee-9a74-cf78e093f87e.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.74% | 95.93% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.72% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.24% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.47% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.09% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.66% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.96% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.72% | 89.00% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.89% | 92.88% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.43% | 96.61% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.00% | 94.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.81% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.87% | 94.45% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.04% | 98.46% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.54% | 92.50% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 82.39% | 97.53% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.75% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.70% | 95.89% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.24% | 91.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.22% | 92.94% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.10% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.95% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 80.43% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clintonia udensis |
PubChem | 102026851 |
LOTUS | LTS0165136 |
wikiData | Q105196449 |