methyl (2R)-2-[(1S,2R,5S,6S,10R,11S,12S,13R,15R,17S,18R)-6-(furan-3-yl)-10,11,12,17-tetrahydroxy-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate
| Internal ID | 4927722c-27d7-44d2-af83-11de57d32854 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | methyl (2R)-2-[(1S,2R,5S,6S,10R,11S,12S,13R,15R,17S,18R)-6-(furan-3-yl)-10,11,12,17-tetrahydroxy-1,5,15-trimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate |
| SMILES (Canonical) | CC12CCC3C4(C(C5(CC4(C(C5=O)C(C3(C1(CC(=O)OC2C6=COC=C6)O)O)O)O)C)C(C(=O)OC)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@@]4([C@H]([C@]5(C[C@@]4([C@H](C5=O)[C@@H]([C@@]3([C@]1(CC(=O)O[C@H]2C6=COC=C6)O)O)O)O)C)[C@H](C(=O)OC)O)C |
| InChI | InChI=1S/C27H34O11/c1-22-11-25(33)15(18(22)30)19(31)27(35)13(24(25,3)17(22)16(29)21(32)36-4)5-7-23(2)20(12-6-8-37-10-12)38-14(28)9-26(23,27)34/h6,8,10,13,15-17,19-20,29,31,33-35H,5,7,9,11H2,1-4H3/t13-,15-,16-,17+,19+,20+,22-,23+,24-,25+,26-,27+/m1/s1 |
| InChI Key | ULRUSPPUNNVTCI-SPMIDVJSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H34O11 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.21011190 g/mol |
| Topological Polar Surface Area (TPSA) | 184.00 Ų |
| XlogP | -1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.09% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.05% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.47% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.26% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.19% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.96% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.68% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.74% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.21% | 91.07% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.60% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.00% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.00% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.16% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.12% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.69% | 100.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.43% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.06% | 92.62% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.54% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Khaya senegalensis |
| PubChem | 163010369 |
| LOTUS | LTS0204524 |
| wikiData | Q105275305 |