5-Amino-1,5-dideoxy-1-(1,2,3,4-tetrahydro-5-hydroxymethyl-2,4-dioxopyrimidin-1-yl)-beta-D-allofuranuronic acid
| Internal ID | d8a606ec-091e-4ed2-b074-249ca780cc6b |
| Taxonomy | Nucleosides, nucleotides, and analogues > 5-deoxyribonucleosides |
| IUPAC Name | 2-amino-2-[3,4-dihydroxy-5-[5-(hydroxymethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]acetic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H15N3O8/c12-4(10(19)20)7-5(16)6(17)9(22-7)14-1-3(2-15)8(18)13-11(14)21/h1,4-7,9,15-17H,2,12H2,(H,19,20)(H,13,18,21) |
| InChI Key | TZQKKPBFBDTCRN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H15N3O8 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.08591445 g/mol |
| Topological Polar Surface Area (TPSA) | 183.00 Ų |
| XlogP | -5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.83% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.73% | 95.56% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.24% | 86.92% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.76% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.65% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.30% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.03% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.25% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.04% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.83% | 97.25% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 81.71% | 100.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.74% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.21% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 418921 |
| LOTUS | LTS0224640 |
| wikiData | Q105268340 |