Dimethyl 2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,7,9,11,14,16,18,20-decaene-4,15-dicarboxylate
| Internal ID | f879d6b7-ba9b-4d37-9b2d-18b2e3bcb550 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthalenecarboxylic acids and derivatives |
| IUPAC Name | dimethyl 2,13-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5,7,9,11,14,16,18,20-decaene-4,15-dicarboxylate |
| SMILES (Canonical) | COC(=O)C1=C2C(=CC3=CC=CC=C31)NC4=C(C5=CC=CC=C5C=C4N2)C(=O)OC |
| SMILES (Isomeric) | COC(=O)C1=C2C(=CC3=CC=CC=C31)NC4=C(C5=CC=CC=C5C=C4N2)C(=O)OC |
| InChI | InChI=1S/C24H18N2O4/c1-29-23(27)19-15-9-5-3-7-13(15)11-17-21(19)25-18-12-14-8-4-6-10-16(14)20(22(18)26-17)24(28)30-2/h3-12,25-26H,1-2H3 |
| InChI Key | HOEOZFXVMJIVGV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.12665706 g/mol |
| Topological Polar Surface Area (TPSA) | 76.70 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.29% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.39% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.54% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.66% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.55% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.41% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.22% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.01% | 98.95% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.58% | 92.67% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.25% | 93.03% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.23% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163068241 |
| LOTUS | LTS0212273 |
| wikiData | Q105031229 |