Ceruletide
| Internal ID | c22763dc-695d-4be5-8a64-cff2649b3d83 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (3S)-3-[[(2S)-5-amino-5-oxo-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoyl]amino]-4-[[(2S)-1-[[(2S,3R)-1-[[2-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-carboxy-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-hydroxy-1-oxobutan-2-yl]amino]-1-oxo-3-(4-sulfooxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CC(C(C(=O)NCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(CC3=CC=CC=C3)C(=O)N)NC(=O)C(CC4=CC=C(C=C4)OS(=O)(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C5CCC(=O)N5)O |
| SMILES (Isomeric) | C[C@H]([C@@H](C(=O)NCC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N)NC(=O)[C@H](CC4=CC=C(C=C4)OS(=O)(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H]5CCC(=O)N5)O |
| InChI | InChI=1S/C58H73N13O21S2/c1-29(72)49(71-57(87)40(23-31-12-14-33(15-13-31)92-94(89,90)91)68-56(86)43(26-48(78)79)69-52(82)37(16-18-44(59)73)65-51(81)36-17-19-45(74)63-36)58(88)62-28-46(75)64-41(24-32-27-61-35-11-7-6-10-34(32)35)54(84)66-38(20-21-93-2)53(83)70-42(25-47(76)77)55(85)67-39(50(60)80)22-30-8-4-3-5-9-30/h3-15,27,29,36-43,49,61,72H,16-26,28H2,1-2H3,(H2,59,73)(H2,60,80)(H,62,88)(H,63,74)(H,64,75)(H,65,81)(H,66,84)(H,67,85)(H,68,86)(H,69,82)(H,70,83)(H,71,87)(H,76,77)(H,78,79)(H,89,90,91)/t29-,36+,37+,38+,39+,40+,41+,42+,43+,49+/m1/s1 |
| InChI Key | YRALAIOMGQZKOW-HYAOXDFASA-N |
| Popularity | 3,601 references in papers |
| Molecular Formula | C58H73N13O21S2 |
| Molecular Weight | 1352.40 g/mol |
| Exact Mass | 1351.44853874 g/mol |
| Topological Polar Surface Area (TPSA) | 585.00 Ų |
| XlogP | -3.00 |
| Atomic LogP (AlogP) | -4.52 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 38 |
| Ceruletide |
| 17650-98-5 |
| Cerulein |
| Ceruletida |
| Ceruletidum |
| 5-Oxo-L-prolyl-L-glutaminyl-L-alpha-aspartyl-O-sulfo-L-tyrosyl-L-threonylglycyl-L-tryptophyl-L-methionyl-L-alpha-aspartyl-L-phenylalaninamide |
| 5-Oxo-L-prolyl-L-glutaminyl-L-aspartyl-L-tyrosyl-L-threonylglycyl-L-tryptophyl-L-methionyl-L-aspartylphenyl-L-alaninamide 4-(hydrogen sulfate) (ester) |
| CHEBI:59219 |
| 888Y08971B |
| Ceruletidum [INN-Latin] |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8134 | 81.34% |
| Caco-2 | - | 0.8682 | 86.82% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.3696 | 36.96% |
| OATP2B1 inhibitior | - | 0.8597 | 85.97% |
| OATP1B1 inhibitior | + | 0.8298 | 82.98% |
| OATP1B3 inhibitior | + | 0.9275 | 92.75% |
| MATE1 inhibitior | - | 0.8609 | 86.09% |
| OCT2 inhibitior | - | 0.7750 | 77.50% |
| BSEP inhibitior | + | 0.9545 | 95.45% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8449 | 84.49% |
| CYP3A4 substrate | + | 0.7488 | 74.88% |
| CYP2C9 substrate | - | 0.8030 | 80.30% |
| CYP2D6 substrate | - | 0.8392 | 83.92% |
| CYP3A4 inhibition | - | 0.9364 | 93.64% |
| CYP2C9 inhibition | - | 0.7725 | 77.25% |
| CYP2C19 inhibition | - | 0.7546 | 75.46% |
| CYP2D6 inhibition | - | 0.8592 | 85.92% |
| CYP1A2 inhibition | - | 0.7836 | 78.36% |
| CYP2C8 inhibition | + | 0.7633 | 76.33% |
| CYP inhibitory promiscuity | - | 0.8493 | 84.93% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | + | 0.5600 | 56.00% |
| Carcinogenicity (trinary) | Non-required | 0.6065 | 60.65% |
| Eye corrosion | - | 0.9790 | 97.90% |
| Eye irritation | - | 0.8961 | 89.61% |
| Skin irritation | - | 0.7652 | 76.52% |
| Skin corrosion | - | 0.9133 | 91.33% |
| Ames mutagenesis | - | 0.8800 | 88.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7159 | 71.59% |
| Micronuclear | + | 0.9100 | 91.00% |
| Hepatotoxicity | - | 0.7375 | 73.75% |
| skin sensitisation | - | 0.8421 | 84.21% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.8667 | 86.67% |
| Mitochondrial toxicity | + | 0.7625 | 76.25% |
| Nephrotoxicity | - | 0.8648 | 86.48% |
| Acute Oral Toxicity (c) | III | 0.5721 | 57.21% |
| Estrogen receptor binding | + | 0.6331 | 63.31% |
| Androgen receptor binding | + | 0.6939 | 69.39% |
| Thyroid receptor binding | + | 0.7129 | 71.29% |
| Glucocorticoid receptor binding | + | 0.7319 | 73.19% |
| Aromatase binding | + | 0.7565 | 75.65% |
| PPAR gamma | + | 0.6886 | 68.86% |
| Honey bee toxicity | - | 0.6617 | 66.17% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.7200 | 72.00% |
| Fish aquatic toxicity | + | 0.7860 | 78.60% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.97% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.82% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.06% | 97.64% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.80% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.91% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 97.39% | 95.38% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 97.17% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.67% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.38% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.28% | 94.66% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.14% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.04% | 94.45% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 95.25% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.05% | 91.81% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.00% | 88.42% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.88% | 97.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.86% | 97.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.66% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.31% | 98.75% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 94.01% | 88.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.54% | 96.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.37% | 98.33% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 93.14% | 99.23% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 92.25% | 99.52% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 91.35% | 96.67% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.18% | 82.69% |
| CHEMBL205 | P00918 | Carbonic anhydrase II | 90.66% | 98.44% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.04% | 98.59% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.89% | 91.19% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.59% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.53% | 95.89% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.14% | 96.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.87% | 92.67% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 88.53% | 96.25% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 88.45% | 82.50% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 88.21% | 85.31% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 87.52% | 95.52% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.85% | 96.67% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.10% | 95.83% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.73% | 91.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.61% | 94.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.05% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.98% | 93.03% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 83.95% | 98.89% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.90% | 99.23% |
| CHEMBL3663 | P62993 | Growth factor receptor-bound protein 2 | 83.54% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.49% | 93.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.31% | 82.86% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.18% | 95.50% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.17% | 96.31% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 82.17% | 97.00% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 82.01% | 95.48% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.01% | 94.75% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.43% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16129675 |
| LOTUS | LTS0195575 |
| wikiData | Q5065299 |