Cerbinal
Internal ID | 7b6325b8-c74f-4a07-bb6c-eb12cccbedcf |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aldehydes > Aryl-aldehydes |
IUPAC Name | methyl 7-formylcyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | COC(=O)C1=COC=C2C1=CC=C2C=O |
SMILES (Isomeric) | COC(=O)C1=COC=C2C1=CC=C2C=O |
InChI | InChI=1S/C11H8O4/c1-14-11(13)10-6-15-5-9-7(4-12)2-3-8(9)10/h2-6H,1H3 |
InChI Key | PNHQFFOWCUDBPX-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C11H8O4 |
Molecular Weight | 204.18 g/mol |
Exact Mass | 204.04225873 g/mol |
Topological Polar Surface Area (TPSA) | 56.50 Ų |
XlogP | 1.30 |
65597-42-4 |
METHYL 7-FORMYLCYCLOPENTA[C]PYRAN-4-CARBOXYLATE |
AKOS032948706 |
FS-8925 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 93.33% | 98.95% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.38% | 98.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.31% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.11% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.05% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.15% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.54% | 91.11% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 83.78% | 87.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.56% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.67% | 90.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.44% | 90.24% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.29% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cerbera manghas |
Cerbera odollam |
Gardenia jasminoides |
PubChem | 13786166 |
LOTUS | LTS0233960 |
wikiData | Q105211942 |