Cephalostatin 6
| Internal ID | dfa40fd4-da55-43d9-9905-8b69fa103ee7 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Hydroxysteroids > 17-hydroxysteroids |
| IUPAC Name | |
| SMILES (Canonical) | CC1C2CC(C3=C4CCC5CC6=C(CC5(C4=CC(=C23)OC17C(CC(O7)(C)C)O)C)N=C8CC9CCC1C(C9(CC8=N6)C)CC(C2(C1=CC1C2(C(C2(O1)C(CC(O2)(C)CO)O)C)O)C)O)O |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2CC(C3=C4CCC5CC6=C(C[C@]5(C4=CC(=C23)OC17C(CC(O7)(C)C)O)C)N=C8CC9CCC1C([C@@]9(CC8=N6)C)C[C@@H]([C@@]2(C1=C[C@@H]1[C@]2(C([C@]2(O1)[C@H](C[C@](O2)(C)CO)O)C)O)C)O)O |
| InChI | InChI=1S/C53H70N2O10/c1-24-30-15-38(57)44-29-12-10-27-14-35-36(19-48(27,6)31(29)16-39(45(30)44)62-52(24)41(59)21-46(3,4)64-52)54-34-13-26-9-11-28-32(49(26,7)20-37(34)55-35)17-40(58)50(8)33(28)18-43-51(50,61)25(2)53(63-43)42(60)22-47(5,23-56)65-53/h16,18,24-28,30,32,38,40-43,56-61H,9-15,17,19-23H2,1-8H3/t24-,25?,26?,27?,28?,30+,32?,38?,40+,41?,42+,43-,47-,48-,49-,50+,51+,52?,53-/m1/s1 |
| InChI Key | GPCYNOXHQAAREG-NADGPVQSSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C53H70N2O10 |
| Molecular Weight | 895.10 g/mol |
| Exact Mass | 894.50304643 g/mol |
| Topological Polar Surface Area (TPSA) | 184.00 Ų |
| XlogP | 4.20 |
| NSC378732 |
| NSC-378732 |
| NCI60_003561 |
| B712496K645 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.94% | 96.09% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 98.68% | 89.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.72% | 97.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.01% | 95.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.82% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.86% | 100.00% |
| CHEMBL204 | P00734 | Thrombin | 90.56% | 96.01% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.20% | 92.94% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.89% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.43% | 95.38% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.50% | 98.46% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.96% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.53% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.38% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.08% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.37% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.47% | 99.17% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.28% | 86.92% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.01% | 97.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.80% | 85.14% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.57% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.41% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6711245 |
| LOTUS | LTS0214996 |
| wikiData | Q105385740 |