Celereoside
Internal ID | b209a0b5-edb7-4819-aff7-02c049b44df2 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
IUPAC Name | 4-hydroxy-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrofuro[3,2-g]chromen-7-one |
SMILES (Canonical) | CC(C)(C1CC2=C(O1)C=C3C(=C2O)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC(C)(C1CC2=C(O1)C=C3C(=C2O)C=CC(=O)O3)OC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C20H24O10/c1-20(2,30-19-18(26)17(25)16(24)12(7-21)29-19)13-5-9-11(27-13)6-10-8(15(9)23)3-4-14(22)28-10/h3-4,6,12-13,16-19,21,23-26H,5,7H2,1-2H3 |
InChI Key | JMWIRXQFQXREAB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O10 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | 0.00 |
Celeroside |
CHEBI:176056 |
4-hydroxy-2-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl]-2,3-dihydrouro[3,2-g]chromen-7-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL220 | P22303 | Acetylcholinesterase | 97.08% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.84% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.56% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.06% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.75% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.75% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.12% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.60% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.63% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.98% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.47% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.18% | 96.09% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.11% | 89.34% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.46% | 97.25% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.84% | 93.65% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.16% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Apium graveolens |
PubChem | 73989751 |
LOTUS | LTS0142764 |
wikiData | Q105131716 |