Celabenzine
Internal ID | 5bcee88f-baf1-4236-8e3e-0b131090def0 |
Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
IUPAC Name | (2S)-9-benzoyl-2-phenyl-1,5,9-triazacyclotridecan-4-one |
SMILES (Canonical) | C1CCN(CCCNC(=O)CC(NC1)C2=CC=CC=C2)C(=O)C3=CC=CC=C3 |
SMILES (Isomeric) | C1CCN(CCCNC(=O)C[C@H](NC1)C2=CC=CC=C2)C(=O)C3=CC=CC=C3 |
InChI | InChI=1S/C23H29N3O2/c27-22-18-21(19-10-3-1-4-11-19)24-14-7-8-16-26(17-9-15-25-22)23(28)20-12-5-2-6-13-20/h1-6,10-13,21,24H,7-9,14-18H2,(H,25,27)/t21-/m0/s1 |
InChI Key | LSYKFBZWBDMZLQ-NRFANRHFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H29N3O2 |
Molecular Weight | 379.50 g/mol |
Exact Mass | 379.22597718 g/mol |
Topological Polar Surface Area (TPSA) | 61.40 Ų |
XlogP | 2.60 |
(2S)-9-benzoyl-2-phenyl-1,5,9-triazacyclotridecan-4-one |
53938-08-2 |
C10578 |
AC1L9DIB |
celabazine |
DTXSID70331974 |
CHEBI:132335 |
Q27106115 |
![2D Structure of Celabenzine 2D Structure of Celabenzine](https://plantaedb.com/storage/docs/compounds/2023/11/celabenzine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase | 96.58% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.56% | 98.95% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 96.45% | 83.57% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.39% | 99.23% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 92.09% | 93.04% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.58% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.50% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.88% | 90.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.90% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.82% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.42% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.34% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 84.77% | 97.50% |
CHEMBL2535 | P11166 | Glucose transporter | 83.97% | 98.75% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.88% | 93.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.40% | 95.83% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.01% | 93.03% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.90% | 95.89% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.77% | 90.24% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.60% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gymnosporia mossambicensis |
PubChem | 442847 |
LOTUS | LTS0265582 |
wikiData | Q27106115 |