Klebsazolicin
| Internal ID | dfbb34af-585a-4a0a-bbd7-86f0b3052f16 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | 2-[[(2S)-2-[[2-[[2-[[(2S,3R)-2-[[2-[(1S)-3-amino-1-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[(1S)-3-amino-1-[[(2S)-2-[[2-[(1S)-1-[[(2S)-2-[[2-[(1S)-3-amino-1-[[2-[[1-[(2S)-2-[[(2S,5S)-2-(3-amino-3-oxopropyl)-5-(hydroxymethyl)-6-oxo-2,5-dihydro-1H-pyrazin-3-yl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]-3-oxopropyl]-1,3-thiazole-4-carbonyl]amino]propanoyl]amino]-2-hydroxyethyl]-1,3-thiazole-4-carbonyl]amino]-3-hydroxypropanoyl]amino]-3-oxopropyl]-1,3-oxazole-4-carbonyl]amino]propanoyl]amino]-3-hydroxypropanoyl]amino]propanoyl]amino]-3-oxopropyl]-1,3-thiazole-4-carbonyl]amino]-3-hydroxybutanoyl]amino]acetyl]amino]acetyl]amino]-4-methylpentanoyl]amino]acetic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NCC(=O)O)NC(=O)CNC(=O)CNC(=O)C(C(C)O)NC(=O)C1=CSC(=N1)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(C)NC(=O)C2=COC(=N2)C(CC(=O)N)NC(=O)C(CO)NC(=O)C3=CSC(=N3)C(CO)NC(=O)C(C)NC(=O)C4=CSC(=N4)C(CC(=O)N)NC(=O)CNC(=O)C5CCCN5C(=O)C(CO)NC6=NC(C(=O)NC6CCC(=O)N)CO |
| SMILES (Isomeric) | C[C@H]([C@@H](C(=O)NCC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)O)NC(=O)C1=CSC(=N1)[C@H](CC(=O)N)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)C2=COC(=N2)[C@H](CC(=O)N)NC(=O)[C@H](CO)NC(=O)C3=CSC(=N3)[C@H](CO)NC(=O)[C@H](C)NC(=O)C4=CSC(=N4)[C@H](CC(=O)N)NC(=O)CNC(=O)C5CCCN5C(=O)[C@H](CO)NC6=N[C@H](C(=O)N[C@H]6CCC(=O)N)CO)O |
| InChI | InChI=1S/C76H107N27O30S3/c1-29(2)12-35(62(122)84-19-56(117)118)88-54(115)17-81-53(114)16-83-71(131)57(33(6)109)102-69(129)47-28-135-74(100-47)38(15-52(80)113)94-59(119)30(3)85-63(123)40(21-105)95-60(120)31(4)86-66(126)44-25-133-72(98-44)36(13-50(78)111)93-65(125)41(22-106)96-68(128)46-27-136-75(101-46)42(23-107)97-61(121)32(5)87-67(127)45-26-134-73(99-45)37(14-51(79)112)89-55(116)18-82-70(130)48-8-7-11-103(48)76(132)43(24-108)91-58-34(9-10-49(77)110)92-64(124)39(20-104)90-58/h25-43,48,57,104-109H,7-24H2,1-6H3,(H2,77,110)(H2,78,111)(H2,79,112)(H2,80,113)(H,81,114)(H,82,130)(H,83,131)(H,84,122)(H,85,123)(H,86,126)(H,87,127)(H,88,115)(H,89,116)(H,90,91)(H,92,124)(H,93,125)(H,94,119)(H,95,120)(H,96,128)(H,97,121)(H,102,129)(H,117,118)/t30-,31-,32-,33+,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,48?,57-/m0/s1 |
| InChI Key | RSVIJELKMXTPMI-CKSXXEILSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C76H107N27O30S3 |
| Molecular Weight | 1975.00 g/mol |
| Exact Mass | 1973.6839286 g/mol |
| Topological Polar Surface Area (TPSA) | 991.00 Ų |
| XlogP | -12.80 |
| Atomic LogP (AlogP) | -13.27 |
| H-Bond Acceptor | 38 |
| H-Bond Donor | 28 |
| Rotatable Bonds | 54 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5775 | 57.75% |
| Caco-2 | - | 0.8607 | 86.07% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.7429 | 74.29% |
| Subcellular localzation | Lysosomes | 0.4938 | 49.38% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8129 | 81.29% |
| OATP1B3 inhibitior | + | 0.9367 | 93.67% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9465 | 94.65% |
| P-glycoprotein inhibitior | + | 0.7418 | 74.18% |
| P-glycoprotein substrate | + | 0.8568 | 85.68% |
| CYP3A4 substrate | + | 0.7513 | 75.13% |
| CYP2C9 substrate | + | 0.8031 | 80.31% |
| CYP2D6 substrate | - | 0.8570 | 85.70% |
| CYP3A4 inhibition | - | 0.9129 | 91.29% |
| CYP2C9 inhibition | - | 0.8633 | 86.33% |
| CYP2C19 inhibition | - | 0.7969 | 79.69% |
| CYP2D6 inhibition | - | 0.8963 | 89.63% |
| CYP1A2 inhibition | - | 0.8609 | 86.09% |
| CYP2C8 inhibition | + | 0.8124 | 81.24% |
| CYP inhibitory promiscuity | - | 0.9526 | 95.26% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.5884 | 58.84% |
| Eye corrosion | - | 0.9844 | 98.44% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7581 | 75.81% |
| Skin corrosion | - | 0.9197 | 91.97% |
| Ames mutagenesis | - | 0.6400 | 64.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7157 | 71.57% |
| Micronuclear | + | 0.8700 | 87.00% |
| Hepatotoxicity | - | 0.5490 | 54.90% |
| skin sensitisation | - | 0.8357 | 83.57% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9778 | 97.78% |
| Mitochondrial toxicity | + | 0.9750 | 97.50% |
| Nephrotoxicity | - | 0.7867 | 78.67% |
| Acute Oral Toxicity (c) | III | 0.5613 | 56.13% |
| Estrogen receptor binding | - | 0.5627 | 56.27% |
| Androgen receptor binding | + | 0.7584 | 75.84% |
| Thyroid receptor binding | + | 0.7825 | 78.25% |
| Glucocorticoid receptor binding | + | 0.8268 | 82.68% |
| Aromatase binding | + | 0.8131 | 81.31% |
| PPAR gamma | + | 0.7500 | 75.00% |
| Honey bee toxicity | - | 0.6566 | 65.66% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.7318 | 73.18% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.93% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.85% | 89.63% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.54% | 83.82% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 98.70% | 93.10% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 98.59% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.94% | 98.33% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 97.03% | 96.21% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 96.89% | 92.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.75% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.57% | 94.45% |
| CHEMBL4801 | P29466 | Caspase-1 | 95.73% | 96.85% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 95.38% | 95.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.27% | 90.71% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.20% | 91.11% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 94.99% | 93.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.93% | 97.25% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.45% | 99.23% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 93.87% | 94.66% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.78% | 97.64% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 93.67% | 90.20% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.59% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.12% | 96.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.61% | 100.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.50% | 97.50% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 92.36% | 94.55% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.21% | 85.14% |
| CHEMBL204 | P00734 | Thrombin | 92.08% | 96.01% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.14% | 82.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.96% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.76% | 95.71% |
| CHEMBL228 | P31645 | Serotonin transporter | 89.71% | 95.51% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.37% | 91.19% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.98% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.74% | 95.38% |
| CHEMBL1801 | P00747 | Plasminogen | 88.56% | 92.44% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.24% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.44% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.98% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.95% | 96.90% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 86.77% | 80.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.18% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.64% | 95.56% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.01% | 96.03% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.78% | 96.47% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.23% | 97.53% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 83.58% | 98.89% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.80% | 85.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.61% | 98.10% |
| CHEMBL1881 | P43116 | Prostanoid EP2 receptor | 82.12% | 93.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.81% | 87.67% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 81.35% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.89% | 97.14% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.84% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684557 |
| LOTUS | LTS0183995 |
| wikiData | Q105244905 |