[(1S,2R,4R,6S,10S)-6-hydroxy-1-methyl-7-methylidene-4-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undecan-2-yl] acetate
| Internal ID | 906cfe31-ce81-4238-9ca2-895b7777c400 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(1S,2R,4R,6S,10S)-6-hydroxy-1-methyl-7-methylidene-4-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undecan-2-yl] acetate |
| SMILES (Canonical) | CC(=C)C1CC(C(=C)CCC2C(O2)(C(C1)OC(=O)C)C)O |
| SMILES (Isomeric) | CC(=C)[C@@H]1C[C@@H](C(=C)CC[C@H]2[C@](O2)([C@@H](C1)OC(=O)C)C)O |
| InChI | InChI=1S/C17H26O4/c1-10(2)13-8-14(19)11(3)6-7-15-17(5,21-15)16(9-13)20-12(4)18/h13-16,19H,1,3,6-9H2,2,4-5H3/t13-,14+,15+,16-,17+/m1/s1 |
| InChI Key | MRQOXTXISWYVBH-HMDCTGQHSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 59.10 Ų |
| XlogP | 2.40 |
| There are no found synonyms. |
![2D Structure of [(1S,2R,4R,6S,10S)-6-hydroxy-1-methyl-7-methylidene-4-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undecan-2-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/ceeeb440-85af-11ee-a548-3bb84b8562b7.jpg "2D Structure of [(1S,2R,4R,6S,10S)-6-hydroxy-1-methyl-7-methylidene-4-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undecan-2-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.34% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 93.15% | 91.19% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.32% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.55% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.89% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.30% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.04% | 92.94% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.03% | 89.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.17% | 96.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.07% | 91.07% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.32% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.07% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.73% | 95.56% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.19% | 92.62% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.06% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea ageratum |
| PubChem | 163035448 |
| LOTUS | LTS0081484 |
| wikiData | Q105170826 |