[(3aR,4R,6S,6aR,9aR,9bR)-9-methyl-3-methylidene-2-oxospiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-4-yl] (5R)-5-methoxy-2,5-dihydrofuran-3-carboxylate
| Internal ID | 070f6611-789f-40f6-9036-8061e178a57d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | [(3aR,4R,6S,6aR,9aR,9bR)-9-methyl-3-methylidene-2-oxospiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-4-yl] (5R)-5-methoxy-2,5-dihydrofuran-3-carboxylate |
| SMILES (Canonical) | CC1=CCC2C1C3C(C(CC24CO4)OC(=O)C5=CC(OC5)OC)C(=C)C(=O)O3 |
| SMILES (Isomeric) | CC1=CC[C@@H]2[C@H]1[C@@H]3[C@@H]([C@@H](C[C@@]24CO4)OC(=O)C5=C[C@@H](OC5)OC)C(=C)C(=O)O3 |
| InChI | InChI=1S/C21H24O7/c1-10-4-5-13-16(10)18-17(11(2)19(22)28-18)14(7-21(13)9-26-21)27-20(23)12-6-15(24-3)25-8-12/h4,6,13-18H,2,5,7-9H2,1,3H3/t13-,14-,15-,16+,17-,18-,21-/m1/s1 |
| InChI Key | SLYKDZDFIZWWKT-WKEUPMFBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 83.60 Ų |
| XlogP | 1.10 |
| There are no found synonyms. |
![2D Structure of [(3aR,4R,6S,6aR,9aR,9bR)-9-methyl-3-methylidene-2-oxospiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-4-yl] (5R)-5-methoxy-2,5-dihydrofuran-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/cecc55e0-845b-11ee-8f71-b3dece77e61a.jpg "2D Structure of [(3aR,4R,6S,6aR,9aR,9bR)-9-methyl-3-methylidene-2-oxospiro[4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-6,2'-oxirane]-4-yl] (5R)-5-methoxy-2,5-dihydrofuran-3-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.25% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.00% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.24% | 85.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.69% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.87% | 96.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.91% | 97.79% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.69% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.67% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.49% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.92% | 94.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.58% | 97.28% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.73% | 93.03% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.52% | 96.43% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.15% | 97.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.10% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Picradeniopsis xylopoda |
| PubChem | 163098077 |
| LOTUS | LTS0084895 |
| wikiData | Q105255755 |