Cebulantin
| Internal ID | 89c75981-badf-4003-90ae-078af281f66b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | (3R,6S,9S,15S,18S,21S)-21-[[(2S)-1-[(1S,2S,5R,8S,10R,20S,23R,26S,27S,30S)-27-[[(2S,3S)-2-[[(1R)-2-(2-aminoacetyl)cyclopentanecarbonyl]amino]-3-methylpentanoyl]amino]-30-benzyl-14,36-di(ethylidene)-10-hydroxy-20-(1H-indol-3-ylmethyl)-2,26-dimethyl-7,13,16,19,22,28,31,34,37,39-decaoxo-3,25-dithia-6,12,15,18,21,29,32,35,38,40-decazatricyclo[21.15.2.08,12]tetracontane-5-carbonyl]pyrrolidine-2-carbonyl]amino]-15-(2-amino-2-oxoethyl)-12-ethylidene-6-(hydroxymethyl)-18-methyl-5,8,11,14,17,20-hexaoxo-9-propan-2-yl-1-thia-4,7,10,13,16,19-hexazacyclodocosane-3-carboxylic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC1C(SCC2C(=O)NC(C(=O)NCC(=O)NC(=CC)C(=O)N3CC(CC3C(=O)NC(CSC(C(C(=O)N2)NC(=O)C(=CC)NC(=O)CNC(=O)C(NC1=O)CC4=CC=CC=C4)C)C(=O)N5CCCC5C(=O)NC6CSCC(NC(=O)C(NC(=O)C(NC(=O)C(=CC)NC(=O)C(NC(=O)C(NC6=O)C)CC(=O)N)C(C)C)CO)C(=O)O)O)CC7=CNC8=CC=CC=C87)C)NC(=O)C9CCCC9C(=O)CN |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)N[C@@H]1[C@@H](SC[C@H]2C(=O)N[C@H](C(=O)NCC(=O)NC(=CC)C(=O)N3C[C@@H](C[C@H]3C(=O)N[C@@H](CS[C@H]([C@H](C(=O)N2)NC(=O)C(=CC)NC(=O)CNC(=O)[C@@H](NC1=O)CC4=CC=CC=C4)C)C(=O)N5CCC[C@H]5C(=O)N[C@@H]6CSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)C(=CC)NC(=O)[C@@H](NC(=O)[C@@H](NC6=O)C)CC(=O)N)C(C)C)CO)C(=O)O)O)CC7=CNC8=CC=CC=C87)C)NC(=O)[C@@H]9CCCC9C(=O)CN |
| InChI | InChI=1S/C95H131N23O26S3/c1-11-45(7)74(114-78(126)54-26-20-25-53(54)69(121)34-96)90(138)116-76-48(10)146-42-64-86(134)106-60(31-50-35-98-58-27-19-18-24-52(50)58)80(128)100-37-72(124)103-57(14-4)93(141)118-38-51(120)32-68(118)88(136)111-65(43-147-47(9)75(92(140)110-64)115-81(129)55(12-2)102-71(123)36-99-79(127)59(107-91(76)139)30-49-22-16-15-17-23-49)94(142)117-29-21-28-67(117)87(135)109-63-40-145-41-66(95(143)144)112-84(132)62(39-119)108-89(137)73(44(5)6)113-82(130)56(13-3)104-83(131)61(33-70(97)122)105-77(125)46(8)101-85(63)133/h12-19,22-24,27,35,44-48,51,53-54,59-68,73-76,98,119-120H,11,20-21,25-26,28-34,36-43,96H2,1-10H3,(H2,97,122)(H,99,127)(H,100,128)(H,101,133)(H,102,123)(H,103,124)(H,104,131)(H,105,125)(H,106,134)(H,107,139)(H,108,137)(H,109,135)(H,110,140)(H,111,136)(H,112,132)(H,113,130)(H,114,126)(H,115,129)(H,116,138)(H,143,144)/t45-,46-,47-,48-,51+,53?,54+,59-,60-,61-,62-,63+,64-,65-,66-,67-,68-,73-,74-,75+,76+/m0/s1 |
| InChI Key | NFKAZFDQELSTCL-ZOSKEMBGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C95H131N23O26S3 |
| Molecular Weight | 2107.40 g/mol |
| Exact Mass | 2106.8831297 g/mol |
| Topological Polar Surface Area (TPSA) | 820.00 Ų |
| XlogP | -4.10 |
| Atomic LogP (AlogP) | -6.86 |
| H-Bond Acceptor | 29 |
| H-Bond Donor | 24 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9300 | 93.00% |
| Caco-2 | - | 0.8597 | 85.97% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.3793 | 37.93% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.7984 | 79.84% |
| OATP1B3 inhibitior | + | 0.9241 | 92.41% |
| MATE1 inhibitior | - | 0.8655 | 86.55% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9680 | 96.80% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8732 | 87.32% |
| CYP3A4 substrate | + | 0.7664 | 76.64% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8466 | 84.66% |
| CYP3A4 inhibition | - | 0.6077 | 60.77% |
| CYP2C9 inhibition | - | 0.7773 | 77.73% |
| CYP2C19 inhibition | - | 0.7220 | 72.20% |
| CYP2D6 inhibition | - | 0.8841 | 88.41% |
| CYP1A2 inhibition | - | 0.8424 | 84.24% |
| CYP2C8 inhibition | + | 0.8712 | 87.12% |
| CYP inhibitory promiscuity | - | 0.7552 | 75.52% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5508 | 55.08% |
| Eye corrosion | - | 0.9855 | 98.55% |
| Eye irritation | - | 0.8952 | 89.52% |
| Skin irritation | - | 0.7595 | 75.95% |
| Skin corrosion | - | 0.9187 | 91.87% |
| Ames mutagenesis | - | 0.5854 | 58.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7115 | 71.15% |
| Micronuclear | + | 0.8300 | 83.00% |
| Hepatotoxicity | + | 0.5375 | 53.75% |
| skin sensitisation | - | 0.8547 | 85.47% |
| Respiratory toxicity | + | 0.8778 | 87.78% |
| Reproductive toxicity | + | 0.9889 | 98.89% |
| Mitochondrial toxicity | + | 0.9625 | 96.25% |
| Nephrotoxicity | + | 0.6339 | 63.39% |
| Acute Oral Toxicity (c) | III | 0.5748 | 57.48% |
| Estrogen receptor binding | - | 0.5874 | 58.74% |
| Androgen receptor binding | + | 0.7649 | 76.49% |
| Thyroid receptor binding | + | 0.8257 | 82.57% |
| Glucocorticoid receptor binding | + | 0.8571 | 85.71% |
| Aromatase binding | + | 0.8281 | 82.81% |
| PPAR gamma | + | 0.7853 | 78.53% |
| Honey bee toxicity | - | 0.5926 | 59.26% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.9824 | 98.24% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.87% | 98.95% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.57% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.03% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.76% | 96.09% |
| CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 98.15% | 95.42% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.53% | 88.42% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.37% | 88.56% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.29% | 95.93% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.08% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.85% | 97.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.83% | 90.08% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.48% | 96.61% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.99% | 96.47% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.48% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.95% | 93.10% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.94% | 96.31% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.81% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.61% | 95.89% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 93.17% | 90.24% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.16% | 82.69% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 92.73% | 95.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.37% | 96.85% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.87% | 98.33% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.30% | 94.66% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 91.22% | 96.76% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 91.17% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.05% | 98.24% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.64% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.28% | 99.23% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 90.23% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.77% | 89.00% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.71% | 96.25% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.52% | 96.90% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.48% | 96.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.11% | 98.75% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.48% | 91.19% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.25% | 97.29% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.03% | 93.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.46% | 92.88% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.43% | 95.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.26% | 90.17% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.50% | 91.71% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.40% | 92.32% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.28% | 100.00% |
| CHEMBL4071 | P08311 | Cathepsin G | 85.27% | 94.64% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.36% | 96.33% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.27% | 94.62% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.22% | 95.71% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 83.15% | 96.69% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.88% | 89.62% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.36% | 97.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.12% | 93.03% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 81.94% | 96.03% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.72% | 100.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.41% | 94.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.28% | 96.25% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 81.24% | 99.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.36% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Melia azedarach |
| PubChem | 146682147 |
| LOTUS | LTS0243514 |
| wikiData | Q104919777 |