10-[3,5-Dihydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-9-(hydroxymethyl)-6a,6b,9,12a-tetramethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid
Internal ID | b3aaa404-d6c1-4e13-8cdb-09aebe0e3c56 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives |
IUPAC Name | 10-[3,5-dihydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-9-(hydroxymethyl)-6a,6b,9,12a-tetramethyl-2-methylidene-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)O)C)C)(C)CO)OC6C(C(C(CO6)O)OC7C(C(C(C(O7)CO)O)O)O)O |
SMILES (Isomeric) | CC12CCC(C(C1CCC3(C2CC=C4C3(CCC5(C4CC(=C)CC5)C(=O)O)C)C)(C)CO)OC6C(C(C(CO6)O)OC7C(C(C(C(O7)CO)O)O)O)O |
InChI | InChI=1S/C40H62O13/c1-20-8-13-40(35(48)49)15-14-38(4)21(22(40)16-20)6-7-26-36(2)11-10-27(37(3,19-42)25(36)9-12-39(26,38)5)52-33-31(47)32(23(43)18-50-33)53-34-30(46)29(45)28(44)24(17-41)51-34/h6,22-34,41-47H,1,7-19H2,2-5H3,(H,48,49) |
InChI Key | MYAWJBMPYZSXJY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H62O13 |
Molecular Weight | 750.90 g/mol |
Exact Mass | 750.41904203 g/mol |
Topological Polar Surface Area (TPSA) | 216.00 Ų |
XlogP | 1.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.75% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.37% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.06% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.61% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.04% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.20% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.05% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.51% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.86% | 86.33% |
CHEMBL5028 | O14672 | ADAM10 | 85.84% | 97.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.25% | 90.71% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.18% | 94.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.02% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.55% | 89.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.56% | 98.10% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.66% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Akebia quinata |
PubChem | 14769474 |
LOTUS | LTS0121502 |
wikiData | Q105174749 |